Chapter 29
Organic Chemicals
1,000 tariff lines · 805 filing-ready 10-digit codes · codes begin with 29
Chapter 29 of the US Harmonized Tariff Schedule covers organic Chemicals. Every code in this chapter starts with the digits 29. Work down the nested list below: the bold headings are broad categories, and the 10-digit statistical codes underneath them are what you actually declare to US Customs. Duty rates shown are the general (Column 1) rates that apply to most trading partners.
Codes in Chapter 29
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2901.10 | Saturated | 6-digit heading | |
| 2901.10.10.00 | Ethane and butane | 10-digit statistical code | Free |
| 2901.10.30.00 | n-Pentane and isopentane | 10-digit statistical code | Free |
| 2901.10.40.00 | Derived in whole or in part from petroleum, shale oil or natural gas | 10-digit statistical code | Free |
| 2901.10.50.00 | Other | 10-digit statistical code | Free |
| 2901.21.00.00 | Ethylene | 10-digit statistical code | Free |
| 2901.22.00.00 | Propene (Propylene) | 10-digit statistical code | Free |
| 2901.23.00.00 | Butene (Butylene) and isomers thereof | 10-digit statistical code | Free |
| 2901.24 | Buta-1,3-diene and isoprene | 6-digit heading | |
| 2901.24.10.00 | Buta-1,3-diene | 10-digit statistical code | Free |
| 2901.24.20.00 | Having a purity of 95 percent or more by weight | 10-digit statistical code | Free |
| 2901.24.50.00 | Other | 10-digit statistical code | Free |
| 2901.29 | Other | 6-digit heading | |
| 2901.29.10 | Derived in whole or in part from petroleum, shale oil or natural gas | 8-digit subheading | Free |
| 2901.29.10.10 | Linear α-olefins (C6-C30), unmixed | 10-digit statistical code | |
| 2901.29.10.50 | Other | 10-digit statistical code | |
| 2901.29.50.00 | Other | 10-digit statistical code | Free |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2902.11.00.00 | Cyclohexane | 10-digit statistical code | Free |
| 2902.19.00 | Other | 8-digit subheading | Free |
| 2902.19.00.10 | Dicyclopentadiene | 10-digit statistical code | |
| 2902.19.00.50 | Other | 10-digit statistical code | |
| 2902.20.00.00 | Benzene | 10-digit statistical code | Free |
| 2902.30.00.00 | Toluene | 10-digit statistical code | Free |
| 2902.41.00.00 | o-Xylene | 10-digit statistical code | Free |
| 2902.42.00.00 | m-Xylene | 10-digit statistical code | Free |
| 2902.43.00.00 | p-Xylene | 10-digit statistical code | Free |
| 2902.44.00.00 | Mixed xylene isomers | 10-digit statistical code | Free |
| 2902.50.00.00 | Styrene | 10-digit statistical code | Free |
| 2902.60.00.00 | Ethylbenzene | 10-digit statistical code | Free |
| 2902.70.00.00 | Cumene | 10-digit statistical code | Free |
| 2902.90 | Other | 6-digit heading | |
| 2902.90.10.00 | Pseudocumene | 10-digit statistical code | Free |
| 2902.90.20.00 | Acenaphthene, chrysene, cymene, dimethylnaphthalenes, fluoranthene, fluorene, indene, mesitylene, methylanthracene, methylnaphthalene, phenanthrene and pyrene | 10-digit statistical code | Free |
| 2902.90.30 | Alkylbenzenes and polyalkylbenzenes | 8-digit subheading | Free |
| 2902.90.30.10 | Dodecylbenzene | 10-digit statistical code | |
| 2902.90.30.50 | Other | 10-digit statistical code | |
| 2902.90.40.00 | Anthracene; and 1,4-Di-(2-methylstyryl)benzene | 10-digit statistical code | Free |
| 2902.90.60.00 | Biphenyl (Diphenyl), in flakes | 10-digit statistical code | Free |
| 2902.90.90.00 | Other | 10-digit statistical code | Free |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2903.11.00 | Chloromethane (Methyl chloride) and chloroethane (Ethyl chloride) | 8-digit subheading | 5.5% |
| 2903.11.00.10 | Chloromethane (Methyl chloride) | 10-digit statistical code | |
| 2903.11.00.20 | Chloroethane (Ethyl chloride) | 10-digit statistical code | |
| 2903.12.00.00 | Dichloromethane (Methylene chloride) | 10-digit statistical code | 3.7% |
| 2903.13.00.00 | Chloroform (Trichloromethane) | 10-digit statistical code | 5.5% |
| 2903.14.00.00 | Carbon tetrachloride | 10-digit statistical code | 2.3% |
| 2903.15.00.00 | Ethylene dichloride (ISO) (1,2-dichloroethane) | 10-digit statistical code | 5.5% |
| 2903.19 | Other | 6-digit heading | |
| 2903.19.05.00 | 1,2-Dichloropropane (Propylene dichloride) and dichlorobutanes | 10-digit statistical code | 5.1% |
| 2903.19.10.00 | Hexachloroethane and tetrachloroethane | 10-digit statistical code | 3.7% |
| 2903.19.30.00 | sec-Butyl chloride | 10-digit statistical code | Free |
| 2903.19.60 | Other | 8-digit subheading | 5.5% |
| 2903.19.60.10 | Methylchloroform (1,1,1-Trichloroethane) | 10-digit statistical code | |
| 2903.19.60.50 | Other | 10-digit statistical code | |
| 2903.21.00.00 | Vinyl chloride (Chloroethylene) | 10-digit statistical code | 5.5% |
| 2903.22.00.00 | Trichloroethylene | 10-digit statistical code | 4.2% |
| 2903.23.00.00 | Tetrachloroethylene (Perchloroethylene) | 10-digit statistical code | 3.4% |
| 2903.29.00.00 | Other | 10-digit statistical code | 5.5% |
| 2903.41.10.00 | Trifluoromethane (HFC-23) | 10-digit statistical code | 3.7% |
| 2903.42.10.00 | Difluoromethane (HFC-32) | 10-digit statistical code | 3.7% |
| 2903.43.10.00 | Fluoromethane (HFC-41), 1,2-difluoroethane (HFC-152) and 1,1-difluoroethane (HFC-152a) | 10-digit statistical code | 3.7% |
| 2903.44.10 | Pentafluoroethane (HFC-125), 1,1,1-trifluoroethane (HFC-143a) and 1,1,2-trifluoroethane (HFC-143) | 8-digit subheading | 3.7% |
| 2903.44.10.10 | 1,1,1,2,2-Pentafluoroethane (HFC-125) | 10-digit statistical code | |
| 2903.44.10.20 | 1,1,1-Trifluoroethane (HFC-143a) | 10-digit statistical code | |
| 2903.44.10.30 | 1,1,2-trifluoroethane (HFC-143) | 10-digit statistical code | |
| 2903.45.10.00 | 1,1,1,2-Tetrafluoroethane (HFC-134a) and 1,1,2,2-tetrafluoroethane (HFC-134) | 10-digit statistical code | 3.7% |
| 2903.46.10.00 | 1,1,1,2,3,3,3-Heptafluoropropane (HFC-227ea),1,1,1,2,2,3-hexafluoropropane (HFC-236cb),1,1,1,2,3,3-hexafluoropropane (HFC-236ea) and 1,1,1,3,3,3-hexafluoropropane (HFC-236fa) | 10-digit statistical code | 3.7% |
| 2903.47.10.00 | 1,1,1,3,3-Pentafluoropropane (HFC-245fa) and 1,1,2,2,3-pentafluoropropane (HFC-245ca) | 10-digit statistical code | 3.7% |
| 2903.48.00.00 | 1,1,1,3,3-Pentafluorobutane (HFC-365mfc) and 1,1,1,2,2,3,4,5,5,5-decafluoropentane (HFC-4310mee) | 10-digit statistical code | 3.7% |
| 2903.49.00.00 | Other | 10-digit statistical code | 3.7% |
| 2903.51.10.00 | 2,3,3,3-Tetrafluoropropene (HFO-1234yf),1,3,3,3-tetrafluoropropene (HFO-1234ze) and (Z)-1,1,1,4,4,4-hexafluoro-2-butene (HFO-1336mzz) | 10-digit statistical code | 3.7% |
| 2903.59 | Other | 6-digit heading | |
| 2903.59.10.10 | 1,1,3,3,3-Pentafluoro-2-(trifluoromethyl)-prop-1-ene | 10-digit statistical code | 3.7% |
| 2903.59.90.00 | Other | 10-digit statistical code | 3.7% |
| 2903.61.00.00 | Methyl bromide (bromomethane) | 10-digit statistical code | Free |
| 2903.62.10.00 | Ethylene dibromide (ISO) (1,2-dibromoethane) | 10-digit statistical code | 5.4% |
| 2903.69 | Other | 6-digit heading | |
| 2903.69.10.00 | Acetylene tetrabromide; alkyl bromides, other than methyl bromide (bromomethane); methylene dibromide; and vinyl bromide | 10-digit statistical code | Free |
| 2903.69.90.00 | Other | 10-digit statistical code | 3.7% |
| 2903.71.01.00 | Chlorodifluoromethane (HCFC-22) | 10-digit statistical code | 3.7% |
| 2903.72.01.00 | Dichlorotrifluoroethanes (HCFC-123) | 10-digit statistical code | 3.7% |
| 2903.73.01.00 | Dichlorofluoroethanes (HCFC-141, 141b) | 10-digit statistical code | 3.7% |
| 2903.74.01.00 | Chlorodifluoroethanes (HCFC-142, 142b) | 10-digit statistical code | 3.7% |
| 2903.75.01.00 | Dichloropentafluoropropanes (HCFC-225, 225ca, 225cb) | 10-digit statistical code | 3.7% |
| 2903.76.01.00 | Bromochlorodifluoromethane (Halon-1211), bromotrifluoromethane (Halon-1301) and dibromotetrafluoroethanes (Halon-2402) | 10-digit statistical code | 3.7% |
| 2903.77.00 | Other, perhalogenated only with fluorine and chlorine | 8-digit subheading | 3.7% |
| 2903.77.00.10 | Trichlorofluoromethane | 10-digit statistical code | |
| 2903.77.00.20 | Trichlorotrifluoroethanes | 10-digit statistical code | |
| 2903.77.00.30 | Dichlorotetrafluoroethane (CFC-114) | 10-digit statistical code | |
| 2903.77.00.40 | Monochloropentafluoroethane (CFC-115) | 10-digit statistical code | |
| 2903.77.00.50 | Dichlorodifluoromethane | 10-digit statistical code | |
| 2903.77.00.80 | Other | 10-digit statistical code | |
| 2903.78.00.00 | Other perhalogenated derivatives | 10-digit statistical code | 3.7% |
| 2903.79 | Other | 6-digit heading | |
| 2903.79.10.00 | Bromochloromethane | 10-digit statistical code | Free |
| 2903.79.90 | Other | 8-digit subheading | 3.7% |
| 2903.79.90.30 | Monochlorotetrafluoroethane (HCFC-124) | 10-digit statistical code | |
| 2903.79.90.70 | Other | 10-digit statistical code | |
| 2903.81.00.00 | 1,2,3,4,5,6-Hexachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN) | 10-digit statistical code | 5.5% |
| 2903.82.00.00 | Aldrin (ISO), chlordane (ISO) and heptachlor (ISO) | 10-digit statistical code | 5.5% |
| 2903.83.00.00 | Mirex (ISO) | 10-digit statistical code | 5.5% |
| 2903.89 | Other | 6-digit heading | |
| 2903.89.05.00 | Dibromoethyldibromocyclohexane | 10-digit statistical code | Free |
| 2903.89.11.00 | Pesticides | 10-digit statistical code | 5.5% |
| 2903.89.15.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2903.89.20.00 | Other | 10-digit statistical code | 5.5% |
| 2903.89.31.00 | Chlorinated, but not otherwise halogenated | 10-digit statistical code | 5.5% |
| 2903.89.40.00 | 1,3,5,7,9,11-Hexabromocyclododecane | 10-digit statistical code | 3.7% |
| 2903.89.60.00 | Tetrabromocyclooctane | 10-digit statistical code | Free |
| 2903.89.70 | Other | 8-digit subheading | 3.7% |
| 2903.89.70.10 | Other hexabromocyclododecanes (HBCDs) | 10-digit statistical code | |
| 2903.89.70.90 | Other | 10-digit statistical code | |
| 2903.91 | Chlorobenzene, o-dichlorobenzene and p-dichlorobenzene | 6-digit heading | |
| 2903.91.10.00 | Chlorobenzene | 10-digit statistical code | 5.5% |
| 2903.91.20.00 | o-Dichlorobenzene | 10-digit statistical code | 5.5% |
| 2903.91.30.00 | p-Dichlorobenzene | 10-digit statistical code | 5.5% |
| 2903.92.00.00 | Hexachlorobenzene (ISO) and DDT (ISO) (clofenotane (INN)), (1,1,1-trichloro-2,2- bis(p-chlorophenyl)ethane) | 10-digit statistical code | 5.5% |
| 2903.93.00.00 | Pentachlorobenzene (ISO) | 10-digit statistical code | 5.5% |
| 2903.94.00.00 | Hexabromobiphenyls | 10-digit statistical code | 5.5% |
| 2903.99 | Other | 6-digit heading | |
| 2903.99.05.00 | 3-Bromo-α,α,α-trifluorotoluene; 2-Chloro-5-bromo-α,α,α-trifluorotoluene; andα-Chloro-3-methyltoluene | 10-digit statistical code | 5.5% |
| 2903.99.08.00 | p-Chlorobenzotrifluoride; and 3,4-Dichlorobenzotrifluoride | 10-digit statistical code | 5.5% |
| 2903.99.10.00 | m-Dichlorobenzene; 1,1-Dichloro-2,2-bis(p-ethylphenyl)ethane; and Trichlorobenzenes | 10-digit statistical code | 5.5% |
| 2903.99.15.00 | Triphenylmethyl chloride | 10-digit statistical code | Free |
| 2903.99.20.00 | Benzyl chloride (α-Chlorotoluene); and Benzotrichloride (α,α,α-Trichlorotoluene) | 10-digit statistical code | 5.5% |
| 2903.99.23.00 | Pentabromoethylbenzene | 10-digit statistical code | Free |
| 2903.99.27.00 | Tribromocumene | 10-digit statistical code | 5.5% |
| 2903.99.30.00 | Pesticides | 10-digit statistical code | 5.5% |
| 2903.99.80.01 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2904.10 | Derivatives containing only sulfo groups, their salts and ethyl esters | 6-digit heading | |
| 2904.10.04.00 | 2-Anthracenesulfonic acid | 10-digit statistical code | 5.5% |
| 2904.10.08.00 | Benzenesulfonyl chloride | 10-digit statistical code | 5.5% |
| 2904.10.10.00 | m-Benzenedisulfonic acid, sodium salt; 1,5-Naphthalenedisulfonic acid; andp-Toluenesulfonyl chloride | 10-digit statistical code | 5.5% |
| 2904.10.15.00 | Mixtures of 1,3,6-naphthalenetrisulfonic acid and 1,3,7-naphthalenetrisulfonic acid | 10-digit statistical code | 5.5% |
| 2904.10.32.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2904.10.37.00 | Other | 10-digit statistical code | 5.5% |
| 2904.10.50.00 | Other | 10-digit statistical code | 4.2% |
| 2904.20 | Derivatives containing only nitro or only nitroso groups | 6-digit heading | |
| 2904.20.10.00 | p-Nitrotoluene | 10-digit statistical code | 5.5% |
| 2904.20.15.00 | p-Nitro-o-xylene | 10-digit statistical code | 5.5% |
| 2904.20.20.00 | Trinitrotoluene | 10-digit statistical code | Free |
| 2904.20.30.00 | 5-tert-Butyl-2,4,6-trinitro-m-xylene (Musk xylol) and other artificial musks | 10-digit statistical code | 5.5% |
| 2904.20.35.00 | Nitrated benzene, nitrated toluene (except p-nitrotoluene), or nitrated naphthalene | 10-digit statistical code | 5.5% |
| 2904.20.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2904.20.45.00 | Other | 10-digit statistical code | 5.5% |
| 2904.20.50.00 | Other | 10-digit statistical code | 5.5% |
| 2904.31.00.00 | Perfluorooctane sulfonic acid | 10-digit statistical code | 3.7% |
| 2904.32.00.00 | Ammonium perfluorooctane sulfonate | 10-digit statistical code | 3.7% |
| 2904.33.00.00 | Lithium perfluorooctane sulfonate | 10-digit statistical code | 3.7% |
| 2904.34.00.00 | Potassium perfluorooctane sulfonate | 10-digit statistical code | 3.7% |
| 2904.35.00.00 | Other salts of perfluorooctane sulfonic acid | 10-digit statistical code | 3.7% |
| 2904.36.00.00 | Perfluorooctane sulfonyl fluoride | 10-digit statistical code | 3.7% |
| 2904.91.00.00 | Trichloronitromethane (chloropicrin) | 10-digit statistical code | 3.7% |
| 2904.99 | Other | 6-digit heading | |
| 2904.99.04.00 | o-Nitrochlorobenzene; andp-Nitrochlorobenzene | 10-digit statistical code | 5.5% |
| 2904.99.08.00 | Other | 10-digit statistical code | 5.5% |
| 2904.99.15.00 | 4-Chloro-3-nitro-α,α,α-trifluorotoluene; 2-Chloro-5-nitro-α,α,α-trifluorotoluene; and 4-Chloro-3,5-dinitro-α,α,α-trifluorotoluene | 10-digit statistical code | 5.5% |
| 2904.99.20.00 | Nitrotoluenesulfonic acids | 10-digit statistical code | 5.5% |
| 2904.99.30.00 | 1-Bromo-2-nitrobenzene; 1,2-Dichloro-4-nitrobenzene and o-Fluoronitrobenzene | 10-digit statistical code | 5.5% |
| 2904.99.35.00 | 4,4'-Dinitrostilbene-2,2'-disulfonic acid | 10-digit statistical code | 5.5% |
| 2904.99.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2904.99.47.00 | Other | 10-digit statistical code | 5.5% |
| 2904.99.50.00 | Other | 10-digit statistical code | 3.7% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2905.11 | Methanol (Methyl alcohol) | 6-digit heading | |
| 2905.11.10.00 | Imported only for use in producing synthetic natural gas (SNG) or for direct use as a fuel | 10-digit statistical code | Free |
| 2905.11.20 | Other | 8-digit subheading | 5.5% |
| 2905.11.20.10 | Imported for use in chemical production, including production of aldehydes, plastics, olefins and resins | 10-digit statistical code | |
| 2905.11.20.15 | For use in wastewater treatment | 10-digit statistical code | |
| 2905.11.20.85 | Other | 10-digit statistical code | |
| 2905.12.00 | Propan-1-ol (Propyl alcohol) and propan-2-ol (Isopropyl alcohol) | 8-digit subheading | 5.5% |
| 2905.12.00.10 | Propan-1-ol | 10-digit statistical code | |
| 2905.12.00.50 | Propan-2-ol | 10-digit statistical code | |
| 2905.13.00.00 | Butan-1-ol (n-Butyl alcohol) | 10-digit statistical code | 5.5% |
| 2905.14 | Other butanols | 6-digit heading | |
| 2905.14.10.00 | tert-Butyl alcohol, having a purity of less than 99 percent by weight | 10-digit statistical code | Free |
| 2905.14.50 | Other | 8-digit subheading | 5.5% |
| 2905.14.50.10 | 2-Methylpropan-1-ol (Isobutyl alcohol) | 10-digit statistical code | |
| 2905.14.50.50 | Other | 10-digit statistical code | |
| 2905.16.00 | Octanol (Octyl alcohol) and isomers thereof | 8-digit subheading | 3.7% |
| 2905.16.00.10 | 2-Ethylhexan-1-ol | 10-digit statistical code | |
| 2905.16.00.50 | Other | 10-digit statistical code | |
| 2905.17.00.00 | Dodecan-1-ol (Lauryl alcohol), hexadecan-1-ol (Cetyl alcohol) and octadecan-1-ol (Stearyl alcohol) | 10-digit statistical code | 5% |
| 2905.19 | Other | 6-digit heading | |
| 2905.19.10.00 | Pentanol (Amyl alcohol) and isomers thereof | 10-digit statistical code | 5.5% |
| 2905.19.90 | Other | 8-digit subheading | 3.7% |
| 2905.19.90.05 | 3,3-Dimethylbutan-2-ol (pinacolyl alcohol) | 10-digit statistical code | |
| 2905.19.90.10 | Decyl alcohol and isomers thereof | 10-digit statistical code | |
| 2905.19.90.20 | Hexyl alcohol and isomers thereof | 10-digit statistical code | |
| 2905.19.90.90 | Other | 10-digit statistical code | |
| 2905.22 | Acyclic terpene alcohols | 6-digit heading | |
| 2905.22.10.00 | Geraniol | 10-digit statistical code | 3% |
| 2905.22.20.00 | Isophytol | 10-digit statistical code | 3.7% |
| 2905.22.50 | Other | 8-digit subheading | 4.8% |
| 2905.22.50.10 | Citronellol | 10-digit statistical code | |
| 2905.22.50.50 | Other | 10-digit statistical code | |
| 2905.29 | Other | 6-digit heading | |
| 2905.29.10.00 | Allyl alcohol | 10-digit statistical code | 5.5% |
| 2905.29.90.00 | Other | 10-digit statistical code | 3.7% |
| 2905.31.00.00 | Ethylene glycol (Ethanediol) | 10-digit statistical code | 5.5% |
| 2905.32.00.00 | Propylene glycol (Propane-1,2-diol) | 10-digit statistical code | 5.5% |
| 2905.39 | Other | 6-digit heading | |
| 2905.39.10.00 | Butylene glycol | 10-digit statistical code | 5.5% |
| 2905.39.20.00 | Neopentyl glycol | 10-digit statistical code | 5.5% |
| 2905.39.60.00 | Hexylene glycol | 10-digit statistical code | Free |
| 2905.39.90.00 | Other | 10-digit statistical code | 5.5% |
| 2905.41.00.00 | 2-Ethyl-2-(hydroxymethyl)propane-1,3-diol (Trimethylolpropane) | 10-digit statistical code | 3.7% |
| 2905.42.00.00 | Pentaerythritol | 10-digit statistical code | 3.7% |
| 2905.43.00.00 | Mannitol | 10-digit statistical code | 4.6% |
| 2905.44.00.00 | D-Glucitol (Sorbitol) | 10-digit statistical code | 4.9% |
| 2905.45.00.00 | Glycerol | 10-digit statistical code | 0.5¢/kg |
| 2905.49 | Other | 6-digit heading | |
| 2905.49.10.00 | Triols and tetrols | 10-digit statistical code | 3.7% |
| 2905.49.20.00 | Esters of glycerol formed with acids of heading 2904 | 10-digit statistical code | 5.5% |
| 2905.49.30.00 | Xylitol | 10-digit statistical code | Free |
| 2905.49.40.00 | Other | 10-digit statistical code | 5.5% |
| 2905.49.50.01 | Other | 10-digit statistical code | 5.5% |
| 2905.51.00.00 | Ethchlorvynol (INN) | 10-digit statistical code | Free |
| 2905.59 | Other | 6-digit heading | |
| 2905.59.10.00 | Derivatives of monohydric alcohols | 10-digit statistical code | 5.5% |
| 2905.59.30.00 | Dibromoneopentylglycol | 10-digit statistical code | Free |
| 2905.59.90.00 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2906.11.00.00 | Menthol | 10-digit statistical code | 2.1% |
| 2906.12.00.00 | Cyclohexanol, methylcyclohexanols and dimethylcyclohexanols | 10-digit statistical code | 5.5% |
| 2906.13 | Sterols and inositols | 6-digit heading | |
| 2906.13.10.00 | Inositols | 10-digit statistical code | Free |
| 2906.13.50.00 | Other | 10-digit statistical code | 3.7% |
| 2906.19 | Other | 6-digit heading | |
| 2906.19.10.00 | 4,4'-Isopropylidenedicyclohexanol; and mixtures containing not less than 90 percent by weight of stereoisomers of 2-isopropyl- 5-methylcyclohexanol, but containing not more than 30 percent by weight of any one such stereoisomer | 10-digit statistical code | Free |
| 2906.19.30.00 | Terpineols | 10-digit statistical code | 5.5% |
| 2906.19.50.00 | Other | 10-digit statistical code | 5.5% |
| 2906.21.00.00 | Benzyl alcohol | 10-digit statistical code | 5.5% |
| 2906.29 | Other | 6-digit heading | |
| 2906.29.10.00 | Phenethyl alcohol | 10-digit statistical code | 5.5% |
| 2906.29.20.00 | Other | 10-digit statistical code | 5.5% |
| 2906.29.30.00 | 1,1-Bis(4-chlorophenyl)- 2,2,2-trichloro-ethanol (Dicofol); andp-Nitrobenzyl alcohol | 10-digit statistical code | Free |
| 2906.29.60.00 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2907.11.00.00 | Phenol (Hydroxybenzene) and its salts | 10-digit statistical code | 5.5% |
| 2907.12.00.00 | Cresols and their salts | 10-digit statistical code | 4.2% |
| 2907.13.00.00 | Octylphenol, nonylphenol and their isomers; salts thereof | 10-digit statistical code | 5.5% |
| 2907.15 | Naphthols and their salts | 6-digit heading | |
| 2907.15.10.00 | α-Naphthol | 10-digit statistical code | 5.5% |
| 2907.15.30.00 | β-Naphthol (2-Naphthol) | 10-digit statistical code | Free |
| 2907.15.60.00 | Other | 10-digit statistical code | 5.5% |
| 2907.19 | Other | 6-digit heading | |
| 2907.19.10.00 | Alkylcresols | 10-digit statistical code | 5.5% |
| 2907.19.20.00 | Alkylphenols | 10-digit statistical code | 5.5% |
| 2907.19.40.00 | Thymol | 10-digit statistical code | 4.2% |
| 2907.19.61.00 | 2-tert-Butylethylphenol; 6-tert-Butyl-2,4-xylenol; and Xylenols and their salts | 10-digit statistical code | Free |
| 2907.19.80.00 | Other | 10-digit statistical code | 5.5% |
| 2907.21.00.00 | Resorcinol and its salts | 10-digit statistical code | 5.5% |
| 2907.22 | Hydroquinone (Quinol) and its salts | 6-digit heading | |
| 2907.22.10.00 | Photographic grade | 10-digit statistical code | 5.5% |
| 2907.22.50.00 | Other | 10-digit statistical code | 5.5% |
| 2907.23.00.00 | 4,4'-Isopropylidenediphenol (Bisphenol A, Diphenylolpropane) and its salts | 10-digit statistical code | 5.5% |
| 2907.29 | Other | 6-digit heading | |
| 2907.29.05.00 | Phenol-alcohols | 10-digit statistical code | 5.5% |
| 2907.29.10.00 | Pyrogallic acid | 10-digit statistical code | 1.3% |
| 2907.29.15.00 | 4,4'-Biphenol | 10-digit statistical code | Free |
| 2907.29.25.00 | tert-Butylhydroquinone | 10-digit statistical code | 5.5% |
| 2907.29.90.00 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2908.11.00.00 | Pentachlorophenol (ISO) | 10-digit statistical code | 5.5% |
| 2908.19 | Other | 6-digit heading | |
| 2908.19.05.00 | 2,2-Bis(4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoro- propane | 10-digit statistical code | Free |
| 2908.19.10.00 | 6-Chloro-m-cresol [OH=1];m-Chlorophenol; and Chlorothymol | 10-digit statistical code | 5.5% |
| 2908.19.15.00 | 3-Hydroxy-α,α,α-trifluorotoluene | 10-digit statistical code | 5.5% |
| 2908.19.20.00 | Salts of pentachlorophenol; and 2,4,5-Trichlorophenol and its salts | 10-digit statistical code | 5.5% |
| 2908.19.25.00 | Tetrabromobisphenol A | 10-digit statistical code | 5.5% |
| 2908.19.35.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2908.19.60.00 | Other | 10-digit statistical code | 5.5% |
| 2908.91.00.00 | Dinoseb (ISO) and its salts | 10-digit statistical code | 5.5% |
| 2908.92.00.00 | 4,6-Dinitro-o-cresol (DNOC) (ISO) and its salts | 10-digit statistical code | 5.5% |
| 2908.99 | Other | 6-digit heading | |
| 2908.99.03.00 | 2,5-Dihydroxybenzenesulfonic acid, potassium salt; 3,6-Dihydroxy-2,7-naphthalenedisulfonic acid; 3,6-Dihydroxy-2,7-naphthalenedisulfonic acid, sodium salt; 4-Hydroxy-1-naphthalenesulfonic acid, sodium salt; 1-Naphthol-3,6-disulfonic acid; and 2-Naphthol-3,6-disulfonic acid and its salts | 10-digit statistical code | 5.5% |
| 2908.99.06.00 | 4-Hydroxy-1-naphthalenesulfonic acid (1-Naphthol-4-sulfonic acid) | 10-digit statistical code | Free |
| 2908.99.09.00 | 1,8-Dihydroxynaphthalene-3,6-disulfonic acid and its disodium salt | 10-digit statistical code | 5.5% |
| 2908.99.12.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2908.99.15.00 | Other | 10-digit statistical code | 5.5% |
| 2908.99.20.00 | p-Nitrophenol | 10-digit statistical code | 5.5% |
| 2908.99.25.00 | Other nitrophenols | 10-digit statistical code | 5.5% |
| 2908.99.33.00 | Dinitro-o-cresols (other than 4,6-dinitro-o-cresol) and 4-nitro-m-cresol | 10-digit statistical code | 5.5% |
| 2908.99.40.00 | Dinitrobutylphenol and its salts | 10-digit statistical code | 5.5% |
| 2908.99.80.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2908.99.90.00 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2909.11.00.00 | Diethyl ether | 10-digit statistical code | 1% |
| 2909.19 | Other | 6-digit heading | |
| 2909.19.14.00 | Methyl tertiary-butyl ether (MTBE) | 10-digit statistical code | 5.5% |
| 2909.19.18.00 | Other | 10-digit statistical code | 5.5% |
| 2909.19.30.00 | Triethylene glycol dichloride | 10-digit statistical code | Free |
| 2909.19.60.00 | Other | 10-digit statistical code | 5.5% |
| 2909.20.00.00 | Cyclanic, cyclenic or cycloterpenic ethers and their halogenated, sulfonated, nitrated or nitrosated derivatives | 10-digit statistical code | 3.7% |
| 2909.30 | Aromatic ethers and their halogenated, sulfonated, nitrated or nitrosated derivatives | 6-digit heading | |
| 2909.30.05.00 | 5-Chloro-2-nitroanisole; 6-Chloro-3-nitro-p-dimethoxybenzene; and Dimethyl diphenyl ether | 10-digit statistical code | 5.5% |
| 2909.30.07.00 | Decabromodiphenyl oxide; and Octabromodiphenyl oxide | 10-digit statistical code | 5.5% |
| 2909.30.09.00 | Bis(tribromophenoxy)ethane; Pentabromodiphenyl oxide; and Tetra decabromodiphenoxy benzene | 10-digit statistical code | Free |
| 2909.30.10.00 | 6-tert-Butyl-3-methyl-2,4-dinitroanisole (Musk ambrette) and other artificial musks | 10-digit statistical code | 5.5% |
| 2909.30.20.00 | Other | 10-digit statistical code | 5.5% |
| 2909.30.30.00 | Pesticides | 10-digit statistical code | 5.5% |
| 2909.30.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2909.30.60.00 | Other | 10-digit statistical code | 5.5% |
| 2909.41.00.00 | 2,2'-Oxydiethanol (Diethylene glycol, Digol) | 10-digit statistical code | 5.5% |
| 2909.43.00.00 | Monobutyl ethers of ethylene glycol or of diethylene glycol | 10-digit statistical code | 5.5% |
| 2909.44.01 | Other monoalkyl ethers of ethylene glycol or of diethylene glycol | 8-digit subheading | 5.5% |
| 2909.44.01.10 | Monomethyl ethers of ethylene glycol or of diethylene glycol | 10-digit statistical code | |
| 2909.44.01.50 | Other | 10-digit statistical code | |
| 2909.49 | Other | 6-digit heading | |
| 2909.49.05.00 | Guaifenesin | 10-digit statistical code | Free |
| 2909.49.10.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2909.49.15.00 | Other | 10-digit statistical code | 5.5% |
| 2909.49.20.00 | Glycerol ethers | 10-digit statistical code | 3.7% |
| 2909.49.30.00 | Dipentaerythritol having a purity of 94 percent or more by weight | 10-digit statistical code | Free |
| 2909.49.60.00 | Other | 10-digit statistical code | 5.5% |
| 2909.50 | Ether-phenols, ether-alcohol-phenols and their halogenated, sulfonated, nitrated or nitrosated derivatives | 6-digit heading | |
| 2909.50.10.00 | 4-Ethylguaiacol | 10-digit statistical code | 5.5% |
| 2909.50.20.00 | Guaiacol and its derivatives | 10-digit statistical code | 5.5% |
| 2909.50.40 | Odoriferous or flavoring compounds | 8-digit subheading | 4.8% |
| 2909.50.40.10 | Eugenol and isoeugenol | 10-digit statistical code | |
| 2909.50.40.50 | Other | 10-digit statistical code | |
| 2909.50.45.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2909.50.50.00 | Other | 10-digit statistical code | 5.5% |
| 2909.60 | Alcohol peroxides, ether peroxides, acetal and hemiacetal peroxides, ketone peroxides and their halogenated, sulfonated, nitrated or nitrosated derivatives | 6-digit heading | |
| 2909.60.10.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2909.60.20.00 | Other | 10-digit statistical code | 5.5% |
| 2909.60.50.00 | Other | 10-digit statistical code | 3.7% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2910.10.00.00 | Oxirane (Ethylene oxide) | 10-digit statistical code | 5.5% |
| 2910.20.00.00 | Methyloxirane (Propylene oxide) | 10-digit statistical code | 5.5% |
| 2910.30.00.00 | 1-Chloro-2,3-epoxypropane (Epichlorohydrin) | 10-digit statistical code | 3.7% |
| 2910.40.00.00 | Dieldrin (ISO, INN) | 10-digit statistical code | 4.8% |
| 2910.50.00.00 | Endrin | 10-digit statistical code | 4.8% |
| 2910.90 | Other | 6-digit heading | |
| 2910.90.10.00 | Butylene oxide | 10-digit statistical code | 4.6% |
| 2910.90.20.00 | Aromatic | 10-digit statistical code | 5.5% |
| 2910.90.91.00 | Other | 10-digit statistical code | 4.8% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2911.00.10.00 | 1,1-Bis(1-methylethoxy)cyclohexane | 10-digit statistical code | Free |
| 2911.00.50.00 | Other | 10-digit statistical code | 5.3% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2912.11.00.00 | Methanal (Formaldehyde) | 10-digit statistical code | 2.8% |
| 2912.12.00.00 | Ethanal (Acetaldehyde) | 10-digit statistical code | 5.5% |
| 2912.19 | Other | 6-digit heading | |
| 2912.19.10.00 | Citral | 10-digit statistical code | 5.5% |
| 2912.19.20.00 | Other | 10-digit statistical code | 4.8% |
| 2912.19.25.00 | Butanal (Butyraldehyde, normal isomer) | 10-digit statistical code | 5.5% |
| 2912.19.30.00 | Glyoxal | 10-digit statistical code | 3.7% |
| 2912.19.40.00 | Isobutanal | 10-digit statistical code | 5.5% |
| 2912.19.50.00 | Other | 10-digit statistical code | 5.5% |
| 2912.21.00.00 | Benzaldehyde | 10-digit statistical code | 5.5% |
| 2912.29 | Other | 6-digit heading | |
| 2912.29.10.00 | Phenylacetaldehyde | 10-digit statistical code | 5.5% |
| 2912.29.30.00 | 3,4-Dimethylbenzaldehyde; Paraldehyde, USP grade; andp-Tolualdehyde | 10-digit statistical code | Free |
| 2912.29.60 | Other | 8-digit subheading | 5.5% |
| 2912.29.60.10 | Odoriferous or flavoring compounds | 10-digit statistical code | |
| 2912.29.60.90 | Other | 10-digit statistical code | |
| 2912.41.00.00 | Vanillin (4-Hydroxy-3-methoxybenzaldehyde) | 10-digit statistical code | 5.5% |
| 2912.42.00.00 | Ethylvanillin (3-Ethoxy-4-hydroxybenzaldehyde) | 10-digit statistical code | 5.5% |
| 2912.49 | Other | 6-digit heading | |
| 2912.49.10.00 | p-Anisaldehyde | 10-digit statistical code | 5.5% |
| 2912.49.15.00 | p-Hydroxybenzaldehyde | 10-digit statistical code | Free |
| 2912.49.26.00 | Other | 10-digit statistical code | 5.5% |
| 2912.49.55.00 | Hydroxycitronellal | 10-digit statistical code | 4.8% |
| 2912.49.60.00 | Other | 10-digit statistical code | 5.1% |
| 2912.49.90.00 | Other | 10-digit statistical code | 4.8% |
| 2912.50 | Cyclic polymers of aldehydes | 6-digit heading | |
| 2912.50.10.00 | Metaldehyde | 10-digit statistical code | Free |
| 2912.50.50.00 | Other | 10-digit statistical code | 5.5% |
| 2912.60.00.00 | Paraformaldehyde | 10-digit statistical code | 5.1% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2913.00.20.00 | 4-Fluoro-3-phenoxybenzaldehyde | 10-digit statistical code | Free |
| 2913.00.40.00 | Other | 10-digit statistical code | 5.5% |
| 2913.00.50.00 | Other | 10-digit statistical code | 5.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2914.11 | Acetone | 6-digit heading | |
| 2914.11.10.00 | Derived in whole or in part from cumene | 10-digit statistical code | 5.5% |
| 2914.11.50.00 | Other | 10-digit statistical code | Free |
| 2914.12.00.00 | Butanone (Methyl ethyl ketone) | 10-digit statistical code | 3.1% |
| 2914.13.00.00 | 4-Methylpentan-2-one (Methyl isobutyl ketone) | 10-digit statistical code | 4% |
| 2914.19.00.00 | Other | 10-digit statistical code | 4% |
| 2914.22 | Cyclohexanone and methylcyclohexanones | 6-digit heading | |
| 2914.22.10.00 | Cyclohexanone | 10-digit statistical code | 5.5% |
| 2914.22.20.00 | Methylcyclohexanones | 10-digit statistical code | 5.5% |
| 2914.23.00.00 | Ionones and methylionones | 10-digit statistical code | 5.5% |
| 2914.29 | Other | 6-digit heading | |
| 2914.29.10.00 | Isophorone | 10-digit statistical code | 4% |
| 2914.29.30.00 | Natural | 10-digit statistical code | Free |
| 2914.29.31.00 | Synthetic | 10-digit statistical code | 2.6% |
| 2914.29.50.00 | Other | 10-digit statistical code | 4.8% |
| 2914.31.00.00 | Phenylacetone (Phenylpropan-2-one) | 10-digit statistical code | 5.5% |
| 2914.39 | Other | 6-digit heading | |
| 2914.39.10.00 | 7-Acetyl-1,1,3,4,4,6-hexamethyl-tetra hydro naphthalene; 1-(2-Naphthalenyl) ethanone; and 6-Acetyl-1,1,2,3,3,5-hexamethylindan | 10-digit statistical code | Free |
| 2914.39.90.00 | Other | 10-digit statistical code | 5.5% |
| 2914.40 | Ketone-alcohols and ketone-aldehydes | 6-digit heading | |
| 2914.40.10.00 | 4-Hydroxy-4-methylpentan-2-one (Diacetone alcohol) | 10-digit statistical code | 4% |
| 2914.40.20.00 | 1,2,3-Indantrione monohydrate (Ninhydrin) | 10-digit statistical code | 5.5% |
| 2914.40.40.00 | Other | 10-digit statistical code | 5.5% |
| 2914.40.60.00 | 1,3-Dihydroxyacetone | 10-digit statistical code | Free |
| 2914.40.90.00 | Other | 10-digit statistical code | 4.8% |
| 2914.50 | Ketone-phenols and ketones with other oxygen function | 6-digit heading | |
| 2914.50.10.00 | 5-Benzoyl-4-hydroxy-2-methoxybenzene-sulfonic acid | 10-digit statistical code | Free |
| 2914.50.30.00 | Other | 10-digit statistical code | 5.5% |
| 2914.50.50.00 | Other | 10-digit statistical code | 4% |
| 2914.61.00.00 | Anthraquinone | 10-digit statistical code | Free |
| 2914.62.00.00 | Coenzyme Q10 (ubidecarenone (INN) | 10-digit statistical code | 5.5% |
| 2914.69 | Other | 6-digit heading | |
| 2914.69.10.00 | Photographic chemicals | 10-digit statistical code | 5.5% |
| 2914.69.21.00 | Drugs | 10-digit statistical code | 5.5% |
| 2914.69.60.00 | 1,4-Dihydroxyanthraquinone; and 2-Ethylanthraquinone | 10-digit statistical code | Free |
| 2914.69.90.00 | Other | 10-digit statistical code | 5.5% |
| 2914.71.00.00 | Chlordecone (ISO) | 10-digit statistical code | 4% |
| 2914.79 | Other | 6-digit heading | |
| 2914.79.10.00 | 2,3-Dichloro-1,4-naphthoquinone 1,8-Dihydroxy-4,5-dinitroanthraquinone; and 4-tert-Butyl-2,6-dimethyl-3,5-dinitroacetophenone (Musk ketone) and other artificial musks | 10-digit statistical code | 5.5% |
| 2914.79.30.00 | Anthraquinone disulfonic acid, sodium salt; and 4-(3,4-Dichlorophenyl)-1-tetralone | 10-digit statistical code | Free |
| 2914.79.40.00 | Other | 10-digit statistical code | 5.5% |
| 2914.79.60.00 | 1-Chloro-5-hexanone | 10-digit statistical code | Free |
| 2914.79.90.00 | Other | 10-digit statistical code | 4% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2915.11.00.00 | Formic acid | 10-digit statistical code | 5.5% |
| 2915.12.00.00 | Salts of formic acid | 10-digit statistical code | 5.5% |
| 2915.13 | Esters of formic acid | 6-digit heading | |
| 2915.13.10.00 | Aromatic | 10-digit statistical code | 5.5% |
| 2915.13.50.00 | Other | 10-digit statistical code | 3.7% |
| 2915.21.00.00 | Acetic acid | 10-digit statistical code | 1.8% |
| 2915.24.00.00 | Acetic anhydride | 10-digit statistical code | 3.5% |
| 2915.29 | Other | 6-digit heading | |
| 2915.29.10.00 | Cupric acetate monohydrate | 10-digit statistical code | Free |
| 2915.29.20.00 | Sodium acetate | 10-digit statistical code | 3.7% |
| 2915.29.30.00 | Cobalt acetates | 10-digit statistical code | 4.2% |
| 2915.29.50.00 | Other | 10-digit statistical code | 2.8% |
| 2915.31.00.00 | Ethyl acetate | 10-digit statistical code | 3.7% |
| 2915.32.00.00 | Vinyl acetate | 10-digit statistical code | 3.8% |
| 2915.33.00.00 | n-Butyl acetate | 10-digit statistical code | 5.5% |
| 2915.36.00.00 | Dinoseb (ISO) acetate | 10-digit statistical code | 5.5% |
| 2915.39 | Other | 6-digit heading | |
| 2915.39.10.00 | Benzyl acetate | 10-digit statistical code | 5.5% |
| 2915.39.20.00 | Other | 10-digit statistical code | 5.5% |
| 2915.39.31.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2915.39.35.00 | Other | 10-digit statistical code | 5.5% |
| 2915.39.40.00 | Linalyl acetate | 10-digit statistical code | 5.5% |
| 2915.39.45 | Other | 8-digit subheading | 4.8% |
| 2915.39.45.10 | n-Propyl acetate | 10-digit statistical code | |
| 2915.39.45.50 | Other | 10-digit statistical code | |
| 2915.39.47.00 | Acetates of polyhydric alcohols or of polyhydric alcohol ethers | 10-digit statistical code | 5.5% |
| 2915.39.60.00 | Bis(bromoacetoxy)butene | 10-digit statistical code | Free |
| 2915.39.70.00 | Isobutyl acetate | 10-digit statistical code | 5.5% |
| 2915.39.80.00 | 2-Ethoxyethyl acetate (Ethylene glycol, monoethyl ether acetate) | 10-digit statistical code | 5.5% |
| 2915.39.90.00 | Other | 10-digit statistical code | 3.7% |
| 2915.40 | Mono-, di- or trichloroacetic acids, their salts and esters | 6-digit heading | |
| 2915.40.10.00 | Chloroacetic acids | 10-digit statistical code | 1.8% |
| 2915.40.20.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 5.5% |
| 2915.40.30.00 | Other | 10-digit statistical code | 5.5% |
| 2915.40.50 | Other | 8-digit subheading | 3.7% |
| 2915.40.50.10 | Sodium chloroacetate | 10-digit statistical code | |
| 2915.40.50.50 | Other | 10-digit statistical code | |
| 2915.50 | Propionic acid, its salts and esters | 6-digit heading | |
| 2915.50.10.00 | Propionic acid | 10-digit statistical code | 4.2% |
| 2915.50.20.00 | Aromatic | 10-digit statistical code | 5.5% |
| 2915.50.50.00 | Other | 10-digit statistical code | 3.7% |
| 2915.60 | Butanoic acids, pentanoic acids, their salts and esters | 6-digit heading | |
| 2915.60.10.00 | Aromatic | 10-digit statistical code | 5.5% |
| 2915.60.50.00 | Other | 10-digit statistical code | 2.1% |
| 2915.70.01 | Palmitic acid, stearic acid, their salts and esters | 8-digit subheading | 5% |
| 2915.70.01.10 | Palmitic acid | 10-digit statistical code | |
| 2915.70.01.20 | Stearic acid | 10-digit statistical code | |
| 2915.70.01.50 | Other | 10-digit statistical code | |
| 2915.90 | Other | 6-digit heading | |
| 2915.90.10 | Fatty acids of animal or vegetable origin | 8-digit subheading | 5% |
| 2915.90.10.10 | Lauric acid | 10-digit statistical code | |
| 2915.90.10.50 | Other | 10-digit statistical code | |
| 2915.90.14.00 | Valproic acid | 10-digit statistical code | 4.2% |
| 2915.90.18 | Other | 8-digit subheading | 4.2% |
| 2915.90.18.10 | Perfluorooctanoic acids and their salts | 10-digit statistical code | |
| 2915.90.18.90 | Other | 10-digit statistical code | |
| 2915.90.20.00 | Aromatic | 10-digit statistical code | 5.5% |
| 2915.90.50 | Other | 8-digit subheading | 3.8% |
| 2915.90.50.10 | Acid chlorides | 10-digit statistical code | |
| 2915.90.50.50 | Other | 10-digit statistical code |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2916.11.00.00 | Acrylic acid and its salts | 10-digit statistical code | 4.2% |
| 2916.12 | Esters of acrylic acid | 6-digit heading | |
| 2916.12.10.00 | Aromatic | 10-digit statistical code | 6.5% |
| 2916.12.50 | Other | 8-digit subheading | 3.7% |
| 2916.12.50.10 | Ethyl acrylate | 10-digit statistical code | |
| 2916.12.50.20 | Methyl acrylate | 10-digit statistical code | |
| 2916.12.50.30 | Butyl acrylate | 10-digit statistical code | |
| 2916.12.50.40 | 2-Ethyl-1-hexyl acrylate | 10-digit statistical code | |
| 2916.12.50.50 | Other | 10-digit statistical code | |
| 2916.13.00.00 | Methacrylic acid and its salts | 10-digit statistical code | 4.2% |
| 2916.14 | Esters of methacrylic acid | 6-digit heading | |
| 2916.14.10.00 | Dicyclopentenyloxyethyl methacrylate | 10-digit statistical code | Free |
| 2916.14.20 | Other | 8-digit subheading | 3.7% |
| 2916.14.20.10 | Ethyl methacrylate | 10-digit statistical code | |
| 2916.14.20.20 | Methyl methacrylate | 10-digit statistical code | |
| 2916.14.20.50 | Other | 10-digit statistical code | |
| 2916.15 | Oleic, linoleic or linolenic acids, their salts and esters | 6-digit heading | |
| 2916.15.10.00 | Oleic, linoleic or linolenic acids | 10-digit statistical code | 6.5% |
| 2916.15.51.00 | Other | 10-digit statistical code | 4.4% |
| 2916.16.00.00 | Binapacryl (ISO) | 10-digit statistical code | 3.7% |
| 2916.19 | Other | 6-digit heading | |
| 2916.19.10.00 | Potassium sorbate | 10-digit statistical code | 3.1% |
| 2916.19.20.00 | Sorbic acid | 10-digit statistical code | 4.2% |
| 2916.19.30.00 | Acids | 10-digit statistical code | 6.1% |
| 2916.19.50.00 | Other | 10-digit statistical code | 3.7% |
| 2916.20 | Cyclanic, cyclenic or cycloterpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives | 6-digit heading | |
| 2916.20.10.00 | (2,3,5,6-Tetrafluoro-4-methylphenyl)methyl- (1α-3α)-(Z)-(±)-3-(2-chloro-3,3,3-trifluoro-1- propenyl-2,2-dimethylcyclopropanecarboxylate) (Tefluthrin) | 10-digit statistical code | Free |
| 2916.20.50.00 | Other | 10-digit statistical code | 3.7% |
| 2916.31 | Benzoic acid, its salts and esters | 6-digit heading | |
| 2916.31.11 | Benzoic acid and its salts | 8-digit subheading | 6.5% |
| 2916.31.11.05 | Benzoic acid | 10-digit statistical code | |
| 2916.31.11.70 | Sodium benzoate | 10-digit statistical code | |
| 2916.31.11.90 | Other | 10-digit statistical code | |
| 2916.31.20.00 | Odoriferous or flavoring compounds | 10-digit statistical code | 6.5% |
| 2916.31.30.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2916.31.50.00 | Other | 10-digit statistical code | 6.5% |
| 2916.32 | Benzoyl peroxide and benzoyl chloride | 6-digit heading | |
| 2916.32.10.00 | Benzoyl peroxide | 10-digit statistical code | 6.5% |
| 2916.32.20.00 | Benzoyl chloride | 10-digit statistical code | 6.5% |
| 2916.34 | Phenylacetic acid and its salts | 6-digit heading | |
| 2916.34.10.00 | Phenylacetic acid (α-Toluic acid) | 10-digit statistical code | 6.5% |
| 2916.34.15.00 | Odoriferous or flavoring compounds | 10-digit statistical code | 6.5% |
| 2916.34.25.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2916.34.55.00 | Other | 10-digit statistical code | Free |
| 2916.39 | Other | 6-digit heading | |
| 2916.39.03.00 | Benzoic anhydride;tert-Butyl peroxybenzoate;p-Nitrobenzoyl chloride; 2-Nitro-m-toluic acid; and 3-Nitro-o-toluic acid | 10-digit statistical code | 6.5% |
| 2916.39.04.00 | m-Chloroperoxybenzoic acid; andp-Sulfobenzoic acid, potassium salt | 10-digit statistical code | Free |
| 2916.39.06.00 | Cinnamic acid | 10-digit statistical code | 6.5% |
| 2916.39.08.00 | 4-Chloro-3-nitrobenzoic acid | 10-digit statistical code | 6.5% |
| 2916.39.12.00 | 4-Chloro-3,5-dinitrobenzoic acid and its esters | 10-digit statistical code | 6.5% |
| 2916.39.15.00 | Ibuprofen | 10-digit statistical code | 6.5% |
| 2916.39.16.00 | 4-Chlorobenzoic acid | 10-digit statistical code | 6.5% |
| 2916.39.17.00 | 2,2-Dichlorophenylacetic acid, ethyl ester; andm-Toluic acid | 10-digit statistical code | Free |
| 2916.39.21.00 | Odoriferous or flavoring compounds | 10-digit statistical code | 6.5% |
| 2916.39.46.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2916.39.77.00 | Esters of phenylacetic acid | 10-digit statistical code | Free |
| 2916.39.79.00 | Other | 10-digit statistical code | 6.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2917.11.00.00 | Oxalic acid, its salts and esters | 10-digit statistical code | 3.1% |
| 2917.12 | Adipic acid, its salts and esters | 6-digit heading | |
| 2917.12.10.00 | Adipic acid | 10-digit statistical code | 6.5% |
| 2917.12.20.00 | Plasticizers | 10-digit statistical code | 6.5% |
| 2917.12.50.00 | Other | 10-digit statistical code | 6.5% |
| 2917.13.00 | Azelaic acid, sebacic acid, their salts and esters | 8-digit subheading | 4.8% |
| 2917.13.00.30 | Sebacic acid | 10-digit statistical code | |
| 2917.13.00.90 | Other | 10-digit statistical code | |
| 2917.14 | Maleic anhydride | 6-digit heading | |
| 2917.14.10.00 | Derived in whole or in part from benzene or other aromatic hydrocarbons | 10-digit statistical code | 6.5% |
| 2917.14.50.00 | Other | 10-digit statistical code | 4.2% |
| 2917.19 | Other | 6-digit heading | |
| 2917.19.10.00 | Ferrous fumarate | 10-digit statistical code | 6.5% |
| 2917.19.15.00 | Derived in whole or in part from aromatic hydrocarbons | 10-digit statistical code | 6.5% |
| 2917.19.17.00 | Other | 10-digit statistical code | 4.2% |
| 2917.19.20.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2917.19.23.00 | Maleic acid | 10-digit statistical code | 6.5% |
| 2917.19.27.00 | Other | 10-digit statistical code | 6.5% |
| 2917.19.30.00 | Ethylene brassylate | 10-digit statistical code | 4.8% |
| 2917.19.35.00 | Malonic acid | 10-digit statistical code | Free |
| 2917.19.40.00 | Derived in whole or in part from aromatic hydrocarbons | 10-digit statistical code | 6.5% |
| 2917.19.70 | Other | 8-digit subheading | 4% |
| 2917.19.70.20 | Plasticizers | 10-digit statistical code | |
| 2917.19.70.50 | Other | 10-digit statistical code | |
| 2917.20.00.00 | Cyclanic, cyclenic or cycloterpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives | 10-digit statistical code | 4.2% |
| 2917.32.00.00 | Dioctyl orthophthalates | 10-digit statistical code | 6.5% |
| 2917.33.00 | Dinonyl or didecyl orthophthalates | 8-digit subheading | 6.5% |
| 2917.33.00.10 | Diisodecyl orthophthalate | 10-digit statistical code | |
| 2917.33.00.50 | Other | 10-digit statistical code | |
| 2917.34.01 | Other esters of orthophthalic acid | 8-digit subheading | 6.5% |
| 2917.34.01.10 | Dibutyl orthophthalate | 10-digit statistical code | |
| 2917.34.01.50 | Other | 10-digit statistical code | |
| 2917.35.00.00 | Phthalic anhydride | 10-digit statistical code | 6.5% |
| 2917.36.00.00 | Terephthalic acid and its salts | 10-digit statistical code | 6.5% |
| 2917.37.00.00 | Dimethyl terephthalate | 10-digit statistical code | 6.5% |
| 2917.39 | Other | 6-digit heading | |
| 2917.39.04.00 | 1,2,4-Benzenetricarboxylic acid, 1,2-dianhydride (Trimellitic anhydride); Phthalic acid; and 4-Sulfo-1,8-naphthalic anhydride | 10-digit statistical code | 6.5% |
| 2917.39.08.00 | Naphthalic anhydride | 10-digit statistical code | Free |
| 2917.39.12.00 | 4,4'-(Hexafluoroisopropylidene)bis(phthalic anhydride) | 10-digit statistical code | Free |
| 2917.39.15.00 | Isophthalic acid | 10-digit statistical code | 6.5% |
| 2917.39.17.00 | Tetrabromophthalic anhydride | 10-digit statistical code | 6.5% |
| 2917.39.20.00 | Plasticizers | 10-digit statistical code | 6.5% |
| 2917.39.30.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2917.39.70.00 | Other | 10-digit statistical code | 6.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2918.11 | Lactic acid, its salts and esters | 6-digit heading | |
| 2918.11.10.00 | Lactic acid | 10-digit statistical code | 5.1% |
| 2918.11.51.00 | Other | 10-digit statistical code | 3.4% |
| 2918.12.00.00 | Tartaric acid | 10-digit statistical code | Free |
| 2918.13 | Salts and esters of tartaric acid | 6-digit heading | |
| 2918.13.10.00 | Potassium antimony tartrate (Tartar emetic) | 10-digit statistical code | Free |
| 2918.13.20.00 | Potassium bitartrate (Cream of tartar) | 10-digit statistical code | Free |
| 2918.13.30.00 | Potassium sodium tartrate (Rochelle salts) | 10-digit statistical code | Free |
| 2918.13.50.00 | Other | 10-digit statistical code | 4.4% |
| 2918.14.00.00 | Citric acid | 10-digit statistical code | 6% |
| 2918.15 | Salts and esters of citric acid | 6-digit heading | |
| 2918.15.10.00 | Sodium citrate | 10-digit statistical code | 6.5% |
| 2918.15.50.00 | Other | 10-digit statistical code | 3.7% |
| 2918.16 | Gluconic acid, its salts and esters | 6-digit heading | |
| 2918.16.10.00 | Gluconic acid | 10-digit statistical code | 6% |
| 2918.16.50 | Other | 8-digit subheading | 3.7% |
| 2918.16.50.10 | Sodium gluconate | 10-digit statistical code | |
| 2918.16.50.20 | Calcium gluconate | 10-digit statistical code | |
| 2918.16.50.90 | Other | 10-digit statistical code | |
| 2918.17.00.01 | 2,2-Diphenyl-2-hydroxyacetic acid (benzilic acid) | 10-digit statistical code | 5.8% |
| 2918.18.00.00 | Chlorobenzilate (ISO) | 10-digit statistical code | 6.5% |
| 2918.19 | Other | 6-digit heading | |
| 2918.19.11.00 | Benzilic acid, methyl ester | 10-digit statistical code | 5.8% |
| 2918.19.12.00 | Mandelic acid | 10-digit statistical code | Free |
| 2918.19.15.00 | Other | 10-digit statistical code | 6.5% |
| 2918.19.20.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2918.19.31.00 | Other | 10-digit statistical code | 6.5% |
| 2918.19.60.00 | Malic acid | 10-digit statistical code | 4% |
| 2918.19.90.00 | Other | 10-digit statistical code | 4% |
| 2918.21 | Salicylic acid and its salts | 6-digit heading | |
| 2918.21.10.00 | Suitable for medicinal use | 10-digit statistical code | 6.5% |
| 2918.21.50.00 | Other | 10-digit statistical code | 6.5% |
| 2918.22 | O-Acetylsalicylic acid, its salts and esters | 6-digit heading | |
| 2918.22.10.00 | O-Acetylsalicylic acid (Aspirin) | 10-digit statistical code | 6.5% |
| 2918.22.50.00 | Salts and esters of O-acetylsalicylic acid | 10-digit statistical code | 6.5% |
| 2918.23 | Other esters of salicylic acid and their salts | 6-digit heading | |
| 2918.23.10.00 | Salol (Phenyl salicylate) suitable for medicinal use | 10-digit statistical code | 6.5% |
| 2918.23.20.00 | Odoriferous or flavoring compounds | 10-digit statistical code | 6.5% |
| 2918.23.30.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2918.23.50.00 | Other | 10-digit statistical code | 6.5% |
| 2918.29 | Other | 6-digit heading | |
| 2918.29.04.00 | 2,3-Cresotic acid; 2-Hydroxybenzoic acid, calcium salt; 1-Hydroxy-2-naphthoic acid; 2-Hydroxy-1-naphthoic acid; 1-Hydroxy-2-naphthoic acid, phenyl ester;α-Resorcylic acid;γ-Resorcylic acid; and 5-Sulfosalicylic acid | 10-digit statistical code | 5.8% |
| 2918.29.06.00 | 1,6-Hexanediol bis(3,5-dibutyl-4-hydroxyphenyl)propionate) | 10-digit statistical code | 5.8% |
| 2918.29.08.00 | m-Hydroxybenzoic acid | 10-digit statistical code | Free |
| 2918.29.20.00 | Gentisic acid; and Hydroxycinnamic acid and its salts | 10-digit statistical code | 6.5% |
| 2918.29.22.00 | p-Hydroxybenzoic acid | 10-digit statistical code | 6.5% |
| 2918.29.25.00 | 3-Hydroxy-2-naphthoic acid | 10-digit statistical code | 6.5% |
| 2918.29.30.00 | Gallic acid | 10-digit statistical code | 1% |
| 2918.29.39.00 | 4,4-Bis(4-hydroxyphenyl) pentanoic acid; and 3,5,6-Trichlorosalicylic acid | 10-digit statistical code | Free |
| 2918.29.65.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2918.29.75.00 | Other | 10-digit statistical code | 6.5% |
| 2918.30 | Carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives | 6-digit heading | |
| 2918.30.10.00 | 1-Formylphenylacetic acid, methyl ester | 10-digit statistical code | 5.8% |
| 2918.30.15.00 | 2-Chloro-4,5-difluoro-ß-oxobenzenepropanoic acid, ethyl ester; and Ethyl 2-keto-4-phenylbutanoate | 10-digit statistical code | Free |
| 2918.30.25 | Products described in additional U.S. note 3 to section VI | 8-digit subheading | 6.5% |
| 2918.30.25.10 | Methyl 3-oxo-2-phenylbutanoate (methyl alpha-phenylacetoacetate, MAPA) | 10-digit statistical code | |
| 2918.30.25.50 | Other | 10-digit statistical code | |
| 2918.30.30.00 | Other | 10-digit statistical code | 6.5% |
| 2918.30.70.00 | Dimethyl acetyl succinate; Oxalacetic acid diethyl ester, sodium salt; 4,4,4-Trifluoro-3-oxobutanoic acid, ethyl ester; and 4,4,4-Trifluoro-3-oxobutanoic acid, methyl ester | 10-digit statistical code | Free |
| 2918.30.90.00 | Other | 10-digit statistical code | 3.7% |
| 2918.91.00.00 | 2,4,5-T (ISO) (2,4,5-trichlorophenoxyacetic acid), its salts and esters | 10-digit statistical code | 6.5% |
| 2918.99 | Other | 6-digit heading | |
| 2918.99.05.00 | p-Anisic acid; Clofibrate; and 3-Phenoxybenzoic acid | 10-digit statistical code | 5.8% |
| 2918.99.06.00 | 1-Hydroxy-6-octadecyloxy-2-naphthalene- carboxylic acid; and 1-Hydroxy-6-docosyloxy-2-naphthalene- carboxylic acid | 10-digit statistical code | Free |
| 2918.99.14.00 | 2-(4-Chloro-2-methylphenoxy)propionic acid and its salts | 10-digit statistical code | Free |
| 2918.99.18.00 | 4-(4-Chloro-2-methylphenoxy) butyric acid;p-Chlorophenoxyacetic acid; and 2-(2,4-Dichlorophenoxy) propionic acid | 10-digit statistical code | 6.5% |
| 2918.99.20 | Other | 8-digit subheading | 6.5% |
| 2918.99.20.10 | 2,4-Dichlorophenoxyacetic acid, its salts and esters | 10-digit statistical code | |
| 2918.99.20.15 | 2-Methyl-4-chlorophenoxyacetic acid | 10-digit statistical code | |
| 2918.99.20.50 | Other | 10-digit statistical code | |
| 2918.99.30.00 | Drugs | 10-digit statistical code | 6.5% |
| 2918.99.35.00 | Odoriferous or flavoring compounds | 10-digit statistical code | 6.5% |
| 2918.99.43 | Products described in additional U.S. note 3 to section VI | 8-digit subheading | 6.5% |
| 2918.99.43.10 | 2-Methyl-3-phenyloxirane-2-carboxylic acid (P-2-P methyl glycidic acid), its salts and esters | 10-digit statistical code | |
| 2918.99.43.50 | Other | 10-digit statistical code | |
| 2918.99.47.00 | Other | 10-digit statistical code | 6.5% |
| 2918.99.50.00 | Other | 10-digit statistical code | 4% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2919.10.00.00 | Tris(2,3-dibromopropyl phosphate) | 10-digit statistical code | 3.7% |
| 2919.90 | Other | 6-digit heading | |
| 2919.90.15.00 | Triphenyl phosphate | 10-digit statistical code | Free |
| 2919.90.25.00 | Other | 10-digit statistical code | 6.5% |
| 2919.90.30.00 | Other | 10-digit statistical code | 6.5% |
| 2919.90.50 | Other | 8-digit subheading | 3.7% |
| 2919.90.50.10 | Plasticizers | 10-digit statistical code | |
| 2919.90.50.50 | Other | 10-digit statistical code |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2920.11.00.00 | Parathion (ISO) and parathion-methyl (ISO) (methyl-parathion) | 10-digit statistical code | Free |
| 2920.19 | Other | 6-digit heading | |
| 2920.19.10.00 | O,O-Dimethyl-O-(4-nitro-m-tolyl)phosphoro- thioate (Fenitrothion) | 10-digit statistical code | 6.5% |
| 2920.19.40.00 | Other | 10-digit statistical code | 6.5% |
| 2920.19.50.00 | Other | 10-digit statistical code | 3.7% |
| 2920.21.00.00 | Dimethyl phosphite | 10-digit statistical code | 3.7% |
| 2920.22.00.00 | Diethyl phosphite | 10-digit statistical code | 3.7% |
| 2920.23.00.00 | Trimethyl phosphite | 10-digit statistical code | 3.7% |
| 2920.24.00.00 | Triethyl phosphite | 10-digit statistical code | 3.7% |
| 2920.29.00.00 | Other | 10-digit statistical code | 3.7% |
| 2920.30.00.00 | Endosulfan (ISO) | 10-digit statistical code | 3.7% |
| 2920.90 | Other | 6-digit heading | |
| 2920.90.10.00 | Pesticides | 10-digit statistical code | 6.5% |
| 2920.90.20.00 | Other | 10-digit statistical code | 6.5% |
| 2920.90.51 | Other | 8-digit subheading | 3.7% |
| 2920.90.51.10 | Ethylene carbonate (1,3-dioxolan-2-one) | 10-digit statistical code | |
| 2920.90.51.50 | Other | 10-digit statistical code |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2921.11.00.00 | Methylamine, di- or trimethylamine and their salts | 10-digit statistical code | 3.7% |
| 2921.12.01.00 | 2-(N,N-Dimethylamino)ethyl chloride hydrochloride | 10-digit statistical code | Free |
| 2921.13.00.00 | 2-(N,N-Diethylamino)ethyl chloride hydrochloride | 10-digit statistical code | Free |
| 2921.14.00.00 | 2-(N,N,-Diisopropylamino)ethyl chloride hydrochloride | 10-digit statistical code | 6.5% |
| 2921.19 | Other | 6-digit heading | |
| 2921.19.11.00 | Mono-, di- and triethylamines;mono-, di-, and tri-(propyl- and butyl-)monoamines; salts of any of the foregoing | 10-digit statistical code | 3.7% |
| 2921.19.31.00 | 3-Amino-3-methyl-1-butyne; (Dimethylamino)isopropyl chloride hydrochloride | 10-digit statistical code | Free |
| 2921.19.61 | Other | 8-digit subheading | 6.5% |
| 2921.19.61.10 | N,N-Dialkyl (methyl, ethyl or n-propyl)-2-chloroethylamines and their protonated salts | 10-digit statistical code | |
| 2921.19.61.20 | Bis(2-chloroethyl)ethylamine) | 10-digit statistical code | |
| 2921.19.61.30 | Chlormethine (INN) (bis(2-chloroethyl)methylamine) | 10-digit statistical code | |
| 2921.19.61.40 | Trichlormethine (INN) (tris(2-chloroethyl)amine) | 10-digit statistical code | |
| 2921.19.61.95 | Other | 10-digit statistical code | |
| 2921.21.00.00 | Ethylenediamine and its salts | 10-digit statistical code | 5.8% |
| 2921.22 | Hexamethylenediamine and its salts | 6-digit heading | |
| 2921.22.05.00 | Hexamethylenediamine adipate (Nylon salt) | 10-digit statistical code | 6.5% |
| 2921.22.10.00 | Derived in whole or in part from adipic acid | 10-digit statistical code | 6.5% |
| 2921.22.50.00 | Other | 10-digit statistical code | 6.5% |
| 2921.29.00 | Other | 8-digit subheading | 6.5% |
| 2921.29.00.10 | Tetraethylene pentamine | 10-digit statistical code | |
| 2921.29.00.20 | Triethylenetetramine | 10-digit statistical code | |
| 2921.29.00.30 | Diethylenetriamine | 10-digit statistical code | |
| 2921.29.00.55 | Other | 10-digit statistical code | |
| 2921.30 | Cyclanic, cyclenic or cycloterpenic mono- or polyamines, and their derivatives; salts thereof | 6-digit heading | |
| 2921.30.05.00 | 1,3-Bis(aminoethyl)cyclohexane | 10-digit statistical code | Free |
| 2921.30.10.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.30.30.00 | Other | 10-digit statistical code | 6.5% |
| 2921.30.50.00 | Other | 10-digit statistical code | 3.7% |
| 2921.41 | Aniline and its salts | 6-digit heading | |
| 2921.41.10.00 | Aniline | 10-digit statistical code | 6.5% |
| 2921.41.20.00 | Aniline salts | 10-digit statistical code | 6.5% |
| 2921.42 | Aniline derivatives and their salts | 6-digit heading | |
| 2921.42.10.00 | N,N-Dimethylaniline | 10-digit statistical code | 6.5% |
| 2921.42.15.00 | N-Ethylaniline; andN,N-Diethylaniline | 10-digit statistical code | 6.5% |
| 2921.42.16.00 | 2,4,5-Trichloroaniline | 10-digit statistical code | Free |
| 2921.42.18.00 | o-Aminobenzenesulfonic acid (Orthanilic acid); 6-Chlorometanilic acid; 2-Chloro-5-nitroaniline; 4-Chloro-3-nitroaniline; 2,3-Dichloroaniline; 2,4-Dichloroaniline; 2,5-Dichloroaniline; 3,5-Dichloroaniline;N,N-Diethylmetanilic acid;N,N-Diethylmetanilic acid, sodium salt; 2,4-Difluoroaniline;p-Fluoroaniline;N-Methylaniline; andm-Nitroaniline | 10-digit statistical code | 5.8% |
| 2921.42.21.00 | Metanilic acid | 10-digit statistical code | 6.5% |
| 2921.42.22.00 | Sulfanilic acid | 10-digit statistical code | 6.5% |
| 2921.42.23.00 | 3,4-Dichloroaniline | 10-digit statistical code | 6.5% |
| 2921.42.36.00 | m-Chloroaniline; 2-Chloro-4-nitroaniline; 2,5-Dichloroaniline-4-sulfonic acid and its monosodium salt; 2,4-Dinitroaniline;o-Nitroaniline-p-sulfonic acid, sodium salt; and 2,3,4-Trifluoroaniline | 10-digit statistical code | Free |
| 2921.42.55.00 | Fast color bases | 10-digit statistical code | 6.5% |
| 2921.42.65.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.42.90.00 | Other | 10-digit statistical code | 6.5% |
| 2921.43 | Toluidines and their derivatives; salts thereof | 6-digit heading | |
| 2921.43.04.00 | 3-Chloro-o-toluidine; and 6-Chloro-o-toluidine | 10-digit statistical code | Free |
| 2921.43.08.00 | 4-Chloro-o-toluidine and hydrochloride; 5-Chloro-o-toluidine; 6-Chloro-2-toluidine-4-sulfonic acid; 4-Chloro-α,α,α-trifluoro-o- toluidine; 2,6-Dichloro-m-toluidine;N,N- Dimethyl-p-toluidine;N-Ethyl-N-benzyl-m-toluidine; andN-Ethyl-o-toluidine | 10-digit statistical code | 5.8% |
| 2921.43.15.00 | α,α,α-Trifluoro-2,6-dinitro-N,N-dipropyl-p- toluidine (Trifluralin) | 10-digit statistical code | 6.5% |
| 2921.43.19.00 | α,α,α-Trifluoro-o-toluidine; andα,α,α-Trifluoro-6-chloro-m-toluidine | 10-digit statistical code | 6.5% |
| 2921.43.22.00 | N-Ethyl-N-(2-methyl-2-propenyl)-2,6- dinitro-4-(trifluoromethyl)benzenamine | 10-digit statistical code | 6.5% |
| 2921.43.24.00 | 2-Amino-5-chloro-4-ethyl benzenesulfonic acid; 2-Amino-5-chloro-p-toluenesulfonic acid;p-Nitro-o-toluidine; and 3-(Trifluoromethyl) aniline (m-Aminobenzotrifluoride) | 10-digit statistical code | Free |
| 2921.43.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.43.90 | Other | 8-digit subheading | 6.5% |
| 2921.43.90.20 | 2-Chloro-p-toluidine-5-sulfonic acid (CAS No. 88-51-7) | 10-digit statistical code | |
| 2921.43.90.40 | p-Toluidine-m-sulfonic acid (CAS No. 88-44-8) | 10-digit statistical code | |
| 2921.43.90.90 | Other | 10-digit statistical code | |
| 2921.44 | Diphenylamine and its derivatives; salts thereof | 6-digit heading | |
| 2921.44.05.00 | 4,4'-Bis (α,α-dimethylbenzyl) diphenylamine; andN-Nitrosodiphenylamine | 10-digit statistical code | Free |
| 2921.44.10.00 | Nitrodiphenylamine | 10-digit statistical code | 6.5% |
| 2921.44.20.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.44.70.00 | Other | 10-digit statistical code | 6.5% |
| 2921.45 | 1-Naphthylamine (α-Naphthylamine), 2-Naphthylamine (β-Naphthylamine), and their derivatives; salts thereof | 6-digit heading | |
| 2921.45.10.00 | 7-Amino-1,3-naphthalenedisulfonic acid and its salts; 5-Amino-2-naphthalenesulfonic acid and its salts; 8-Amino-1-naphthalenesulfonic acid and its salts; andN-Phenyl-2-naphthylamine | 10-digit statistical code | 6.5% |
| 2921.45.20.00 | 3-Amino-2,7-naphthalenedisulfonic acid; 4-Amino-1-naphthalenesulfonic acid, sodium salt; 5-Amino-1-naphthalenesulfonic acid (Laurent's acid); 8-Amino-2-naphthalenesulfonic acid and its salts; 7-Amino-1,3,6-naphthalenetrisulfonic acid; 8-Anilino-1-naphthalenesulfonic acid (Phenyl Peri acid) and its salts; andN-Ethyl-1-naphthylamine | 10-digit statistical code | 5.8% |
| 2921.45.25.00 | Mixtures of 5- and 8-amino-2-naphthalene- sulfonic acid; 2-Naphthylamine-6-sulfonic acid; ando-Naphthionic acid (1-amino- 2-naphthalene- sulfonic acid) | 10-digit statistical code | Free |
| 2921.45.60.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.45.90 | Other | 8-digit subheading | 6.5% |
| 2921.45.90.10 | 2-Amino-1-naphthalenesulfonic acid (Tobias acid) | 10-digit statistical code | |
| 2921.45.90.90 | Other | 10-digit statistical code | |
| 2921.46.00.00 | Amfetamine (INN), benzfetamine (INN), dexamfetamine (INN), etilamfetamine (INN), fencamfamin (INN), lefetamine (INN), levamfetamine (INN), mefenorex (INN) and phentermine (INN); salts thereof | 10-digit statistical code | Free |
| 2921.49 | Other | 6-digit heading | |
| 2921.49.10.00 | 4-Amino-2-stilbenesulfonic acid and its salts;p-Ethylaniline; 2,4,6-Trimethylaniline (Mesidine); 2,3-Xylidine; 2,4-Xylidine; 2,5-Xylidine; and 3,4-Xylidine | 10-digit statistical code | 5.8% |
| 2921.49.15.00 | m-Nitro-p-toluidine | 10-digit statistical code | Free |
| 2921.49.32.00 | Fast color bases | 10-digit statistical code | 6.5% |
| 2921.49.38.00 | Antidepressants, tranquilizers and other psychotherapeutic agents | 10-digit statistical code | 6.5% |
| 2921.49.43.00 | Other | 10-digit statistical code | 6.5% |
| 2921.49.45.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.49.50.00 | Other | 10-digit statistical code | 6.5% |
| 2921.51 | o-, m-, p-Phenylenediamine, diaminotoluenes, and their derivatives; salts thereof | 6-digit heading | |
| 2921.51.10.00 | 4-Amino-2-(N,N-diethylamino) toluene hydrochloride;m-Phenylenediamine;o-Phenylenediamine; Toluene-2,4-diamine; Toluene-2,5-diamine; and Toluene-2,5-diamine sulfate | 10-digit statistical code | 6.5% |
| 2921.51.20.00 | Photographic chemicals | 10-digit statistical code | 6.5% |
| 2921.51.30.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.51.50.00 | Other | 10-digit statistical code | 6.5% |
| 2921.59 | Other | 6-digit heading | |
| 2921.59.04.00 | 1,8-Diaminonaphthalene (1,8-Naphthalenediamine) | 10-digit statistical code | Free |
| 2921.59.08.00 | 5-Amino-2-(p-aminoanilino) benzenesulfonic acid; 4,4'-Diamino-3-biphenylsulfonic acid (3-Benzidinesulfonic acid); 3,3'-Dimethylbenzidine (o-Tolidine); 3,3'-Dimethylbenzidine hydrochloride; Ethyl-(2-dimethylaminoethyl) aniline;N-Ethyl-N,N'-dimethyl-N'-phenylethylene- diamine; and 4,4'-Methylenebis(2-chloroaniline) | 10-digit statistical code | 5.8% |
| 2921.59.17.00 | 4,4'-Benzidine-2,2'-disulfonic acid; 1,4-Diaminobenzene-2-sulfonic acid; 4,4'-Methylene bis ((3-chloro-2,6-diethylaniline); 4,4'-Methylene bis(2,6-diethylaniline); 4,4'-Methylene bis (2,6-diisopropylaniline);m-Xylene diamine; and 3,3'-Diaminobenzidine (tetraaminobiphenyl) | 10-digit statistical code | Free |
| 2921.59.20.00 | 4,4'-Diamino-2,2'-stilbenedisulfonic acid | 10-digit statistical code | 6.5% |
| 2921.59.30.00 | 4,4'-Methylenedianiline | 10-digit statistical code | 6.5% |
| 2921.59.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2921.59.80 | Other | 8-digit subheading | 6.5% |
| 2921.59.80.10 | 3,3'-Dichlorobenzidine dihydrochloride | 10-digit statistical code | |
| 2921.59.80.90 | Other | 10-digit statistical code |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2922.11.00.00 | Monoethanolamine and its salts | 10-digit statistical code | 6.5% |
| 2922.12.00.01 | Diethanolamine and its salts | 10-digit statistical code | 6.5% |
| 2922.14.00.00 | Dextropropoxyphene (INN) and its salts | 10-digit statistical code | Free |
| 2922.15.00.00 | Triethanolamine | 10-digit statistical code | 6.5% |
| 2922.16.00.00 | Diethylammonium perfluorooctane sulfonate | 10-digit statistical code | 6.5% |
| 2922.17.00.00 | Methyldiethanolamine and ethyldiethanolamine | 10-digit statistical code | 6.5% |
| 2922.18.00.00 | 2-(N,N-Diisopropylamino)ethanol | 10-digit statistical code | 6.5% |
| 2922.19 | Other | 6-digit heading | |
| 2922.19.09 | Drugs | 8-digit subheading | 6.5% |
| 2922.19.09.10 | Diphenhydramine (INN) and its salts | 10-digit statistical code | |
| 2922.19.09.90 | Other | 10-digit statistical code | |
| 2922.19.20.00 | 4,4'-Bis(dimethylamino) benzhydrol (Michler's hydrol); 5'-[3'-(Dimethylamino) propyl]-10',11'- dihydro-5H'-dibenzo [a,b] cyclohept- en-5'-ol (Dibenzcarbinol); and 1-(p-Nitrophenyl)-2-amino-1,3- propanediol | 10-digit statistical code | 5.8% |
| 2922.19.33.00 | N1-(2-Hydroxyethyl)-2-nitro-1,4- phenylenediamine;N1,N4,N4- Tris(2-hydroxyethyl)-2- nitro-1,4- phenylenediamine;N1,N4-Dimethyl-N1- (2-hydroxyethyl)-3-nitro-1,4- phenylene- diamine;N1,N4-Dimethyl-N1-(2,3-dihydroxy- propyl)-3-nitro-1,4- phenylenediamine; andN1-(2-Hydroxyethyl)-3-nitro-1,4- phenylenediamine | 10-digit statistical code | Free |
| 2922.19.60.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.19.70.00 | Other | 10-digit statistical code | 6.5% |
| 2922.19.90.00 | Salts of triethanolamine | 10-digit statistical code | 6.5% |
| 2922.19.96 | Other | 8-digit subheading | 6.5% |
| 2922.19.96.10 | N,N-Dimethyl-2-aminoethanol, N,N-diethyl-2-aminoethanol and their protonated salts | 10-digit statistical code | |
| 2922.19.96.19 | Other | 10-digit statistical code | |
| 2922.19.96.90 | Other | 10-digit statistical code | |
| 2922.21 | Aminohydroxynaphthalenesulfonic acids and their salts | 6-digit heading | |
| 2922.21.10.00 | 1-Amino-8-hydroxy-3,6-naphthalenedisulfonic acid; 4-Amino-5-hydroxy-1,3-naphthalenedisulfonic acid (Chicago acid); 4-Amino-5-hydroxy-1,3-naphthalenedisulfonic acid, potassium salt; 4-Amino-5-hydroxy-1,3-naphthalenedisulfonic acid, sodium salt; 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, monosodium salt (H acid, monosodium salt); 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, potassium salt (H acid, monopotassium salt); 4-Amino-3-hydroxy-1-naphthalenesulfonic acid; 6-Amino-1-naphthol-3-sulfonic acid and its salts; and 8-Amino-1-naphthol-5-sulfonic acid and its salts | 10-digit statistical code | 5.8% |
| 2922.21.25.00 | 1-Amino-8-hydroxy-4,6-naphthalenedisulfonic acid, monosodium salt | 10-digit statistical code | Free |
| 2922.21.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.21.50.00 | Other | 10-digit statistical code | 6.5% |
| 2922.29 | Other | 6-digit heading | |
| 2922.29.03.00 | o-Anisidine;p-Anisidine; andp-Phenetidine | 10-digit statistical code | 6.5% |
| 2922.29.06.00 | Fast color bases | 10-digit statistical code | Free |
| 2922.29.08.00 | Other | 10-digit statistical code | Free |
| 2922.29.10.00 | 2-Amino-6-chloro-4-nitrophenol; 2-Amino-4-chlorophenol; 2-Amino-4-chlorophenol hydrochloride; 2-Amino-p-cresol; 4-Amino-o-cresol; 6-Amino-2,4-dichloro-3-methylphenol; 2-(3-Amino-4-hydroxyphenylsulfonyl)ethanol; 2-Amino-4-nitrophenol; 2-Amino-4-nitrophenol, sodium salt; 2-Amino-5-nitrophenol;m-Aminophenol; 2-(4'-Aminophenoxy)ethylsulfate; 5-Chloro-2-(2',4'-dichlorophenoxy)aniline; 3,4-Dimethoxyphenethylamine (Homoveratrylamine); 2-Hydroxy-5-nitrometanilic acid; 4-Methoxymetanilic acid; 6-Methoxymetanilic acid; 4-Methoxy-m-phenylenediamine; 5-Methoxy-m-phenylenediamine sulfate; 6-(Methylamino)-1-naphthol-3-sulfonic acid; 7-(Methylamino)-1-naphthol-3-sulfonic acid; and 2-Methyl-p-anisidine | 10-digit statistical code | 5.8% |
| 2922.29.13.00 | o-Aminophenol; and 2,2-Bis[4-(4-aminophenoxy)phenyl]propane | 10-digit statistical code | Free |
| 2922.29.15.00 | m-Diethylaminophenol;m-Dimethylaminophenol; 3-Ethylamino-p-cresol; and 5-Methoxy-m-phenylenediamine | 10-digit statistical code | 6.5% |
| 2922.29.20.00 | 4-Chloro-2,5-dimethoxyaniline; and 2,4-Dimethoxyaniline | 10-digit statistical code | Free |
| 2922.29.26.00 | Fast color bases | 10-digit statistical code | 6.5% |
| 2922.29.27.00 | Drugs | 10-digit statistical code | 6.5% |
| 2922.29.29.00 | Photographic chemicals | 10-digit statistical code | 6.5% |
| 2922.29.61.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.29.81 | Other | 8-digit subheading | 6.5% |
| 2922.29.81.10 | p-Nitro-o-anisidine | 10-digit statistical code | |
| 2922.29.81.90 | Other | 10-digit statistical code | |
| 2922.31.00.00 | Amfepramone (INN), methadone (INN) and normethadone (INN); salts thereof | 10-digit statistical code | Free |
| 2922.39 | Other | 6-digit heading | |
| 2922.39.05.00 | 1-Amino-2,4-dibromoanthraquinone; and 2-Amino-5-chlorobenzophenone | 10-digit statistical code | Free |
| 2922.39.10.00 | 2'-Amino aceto phenone; 3'-Amino aceto phenone; 1-Amino-4-bromo-2-methyl anthra quinone; 1,4-Bis [1-anthra quinonyl amino] anthra- quinone; 1,4-Di mesi dino anthra quinone; 4-Dimethyl amino benzaldehyde; and Imino di anthra quinone | 10-digit statistical code | 5.8% |
| 2922.39.14.00 | 2-Aminoanthraquinone | 10-digit statistical code | 6.5% |
| 2922.39.17.00 | 1-Aminoanthraquinone | 10-digit statistical code | Free |
| 2922.39.25.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.39.45.00 | Other | 10-digit statistical code | 6.5% |
| 2922.39.50.00 | Other | 10-digit statistical code | 6.5% |
| 2922.41.00 | Lysine and its esters; salts thereof | 8-digit subheading | 3.7% |
| 2922.41.00.10 | Meeting requirements of Food Chemical Codex, Codex Alimentarius or United States Pharmacopeia | 10-digit statistical code | |
| 2922.41.00.90 | Other | 10-digit statistical code | |
| 2922.42 | Glutamic acid and its salts | 6-digit heading | |
| 2922.42.10.00 | Monosodium glutamate | 10-digit statistical code | 6.5% |
| 2922.42.50.00 | Other | 10-digit statistical code | 3.7% |
| 2922.43 | Anthranilic acid and its salts | 6-digit heading | |
| 2922.43.10.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.43.50.00 | Other | 10-digit statistical code | 6.5% |
| 2922.44.00.00 | Tilidine (INN) and its salts | 10-digit statistical code | Free |
| 2922.49 | Other | 6-digit heading | |
| 2922.49.05.00 | (R)-α-Aminobenzeneacetic acid; 2-Amino-3-chlorobenzoic acid, methyl ester | 10-digit statistical code | Free |
| 2922.49.10.00 | m-Aminobenzoic acid, technical;p-Aminobenzoic acid; 3,5-Diaminobenzoic acid; 2-Ethylamino-5-sulfobenzoic acid; 3-(N-Ethylanilino)propionic acid, methyl ester;β-(β-Methoxyethoxyethyl)-4-aminobenzoate; Methyl anthranilate; andl-Phenylalanine | 10-digit statistical code | 5.8% |
| 2922.49.26.00 | Drugs | 10-digit statistical code | 6.5% |
| 2922.49.30.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.49.37.00 | Other | 10-digit statistical code | 6.5% |
| 2922.49.43.00 | Glycine (Aminoacetic acid) | 10-digit statistical code | 4.2% |
| 2922.49.49 | Other amino acids | 8-digit subheading | 4.2% |
| 2922.49.49.10 | Alanine | 10-digit statistical code | |
| 2922.49.49.15 | l-Aspartic acid | 10-digit statistical code | |
| 2922.49.49.50 | Other | 10-digit statistical code | |
| 2922.49.60.00 | 3-Aminocrotonic acid, methyl ester; and (R)-α-Amino-1,4-cyclohexadiene-1- acetic acid | 10-digit statistical code | Free |
| 2922.49.80.00 | Other | 10-digit statistical code | 3.7% |
| 2922.50 | Amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function | 6-digit heading | |
| 2922.50.07.00 | 3,4-Diaminophenetole dihydrogen sulfate; 2-Nitro-5-[(2,3-dihydroxy) propoxy]-N- methyl aniline; 2-Nitro-5-(2-hydroxy ethoxy)-N-methyl aniline; 4-(2-Hydroethoxy)-1,3-phenylene diamine dihydro chloride; 3-Methoxy-4-[(2-hydroxy ethyl) amino] nitro- benzene; 4-[(2-Hydroxy ethyl) amino]-3-nitro phenol; and (R)-α-Amino-4-hydroxy benzene acetic acid (d(-)-p-Hydroxy phenyl glycine) | 10-digit statistical code | Free |
| 2922.50.10.00 | dl-3-(3,4-Di hydroxy phenyl) alanine;N-Ethyl-N-(2-methoxy carbonyl ethyl) aniline;dl-Phenyl ephrine base; and Carbonic acid, methyl ester, diester with 2,2'-(m-tolyl amino) diethanol (Toluidine carbonate) | 10-digit statistical code | 5.8% |
| 2922.50.11.00 | Salts of d(-)-p-Hydroxyphenylglycine ((R)- α-Amino-4-hydroxybenzeneacetic acid) | 10-digit statistical code | 6.5% |
| 2922.50.13 | Isoetharine hydrochloride; Isoxsuprine hydrochloride; Nylidrin hydrochloride; Phenylephrine hydrochloride; Salbutamol (Albuterol); and Terbutaline sulfate | 8-digit subheading | Free |
| 2922.50.13.10 | Phenylephrine (INN) and its salts | 10-digit statistical code | |
| 2922.50.13.90 | Other | 10-digit statistical code | |
| 2922.50.14.00 | Cardiovascular drugs | 10-digit statistical code | 6.5% |
| 2922.50.17.00 | Dermatological agents and local anesthetics | 10-digit statistical code | 6.5% |
| 2922.50.19.00 | Guaiacol derivatives | 10-digit statistical code | 6.5% |
| 2922.50.25.00 | Other | 10-digit statistical code | 6.5% |
| 2922.50.35.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2922.50.40.00 | Other | 10-digit statistical code | 6.5% |
| 2922.50.50.00 | Other | 10-digit statistical code | 6.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2923.10.00.00 | Choline and its salts | 10-digit statistical code | 3.7% |
| 2923.20 | Lecithins and other phosphoaminolipids | 6-digit heading | |
| 2923.20.10.00 | Purified egg phospholipids, pharmaceutical grade meeting requirements of the U.S. Food and Drug Administration, for use in intravenous fat emulsion | 10-digit statistical code | Free |
| 2923.20.20 | Other | 8-digit subheading | 5% |
| 2923.20.20.10 | Certified organic lecithins | 10-digit statistical code | |
| 2923.20.20.50 | Other | 10-digit statistical code | |
| 2923.30.00.00 | Tetraethylammonium perfluorooctane sulfonate | 10-digit statistical code | 6.2% |
| 2923.40.00.00 | Didecylmethylammonium perfluorooctane sulfonate | 10-digit statistical code | 6.2% |
| 2923.90.01.00 | Other | 10-digit statistical code | 6.2% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2924.11.00.00 | Meprobamate (INN) | 10-digit statistical code | Free |
| 2924.12.00.00 | Fluoroacetamide (ISO), monocrotophos (ISO) and phosphamidon (ISO) | 10-digit statistical code | 3.7% |
| 2924.19 | Other | 6-digit heading | |
| 2924.19.11 | Amides | 8-digit subheading | 3.7% |
| 2924.19.11.10 | Acrylamide | 10-digit statistical code | |
| 2924.19.11.20 | Dimethylformamide | 10-digit statistical code | |
| 2924.19.11.30 | Methacrylamide | 10-digit statistical code | |
| 2924.19.11.50 | Other | 10-digit statistical code | |
| 2924.19.80.00 | Other | 10-digit statistical code | 6.5% |
| 2924.21 | Ureines and their derivatives; salts thereof | 6-digit heading | |
| 2924.21.04.00 | 3-(p-Chlorophenyl)-1,1-dimethylurea (Monuron) | 10-digit statistical code | 6.5% |
| 2924.21.08.00 | 1,1-Dimethyl-3-(α,α,α-trifluoro-m- tolyl)urea (Fluometuron) | 10-digit statistical code | Free |
| 2924.21.12.00 | 1-(2-Methylcyclohexyl)-3-phenylurea | 10-digit statistical code | Free |
| 2924.21.16.00 | Other | 10-digit statistical code | 6.5% |
| 2924.21.18.00 | sym-Diethyldiphenylurea | 10-digit statistical code | 6.5% |
| 2924.21.20.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2924.21.45.00 | Other | 10-digit statistical code | 6.5% |
| 2924.21.50.00 | Other | 10-digit statistical code | 6.5% |
| 2924.23 | 2-Acetamidobenzoic acid (N-acetylanthranilic acid) and its salts | 6-digit heading | |
| 2924.23.10.00 | 2-Acetamidobenzoic acid | 10-digit statistical code | 6.5% |
| 2924.23.70.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2924.23.75.00 | Other | 10-digit statistical code | 6.5% |
| 2924.24.00.00 | Ethinamate (INN) | 10-digit statistical code | Free |
| 2924.25.00.00 | Alachlor (ISO) | 10-digit statistical code | 6.5% |
| 2924.29 | Other | 6-digit heading | |
| 2924.29.01.00 | p-Acetanisidide;p-Acetoacetotoluidide; 4'-Amino-N-methylacetanilide; 2,5-Dimethoxyacetanilide; andN-(7-Hydroxy-1-naphthyl)acetamide | 10-digit statistical code | Free |
| 2924.29.03.00 | 3,5-Dinitro-o-toluamide | 10-digit statistical code | Free |
| 2924.29.05.00 | Biligrafin acid; 3,5-Diacetamido-2,4,6-triiodobenzoic acid; and Metrizoic acid | 10-digit statistical code | 5.3% |
| 2924.29.10.00 | Acetanilide;N-Acetylsulfanilyl chloride; Aspartame; and 2-Methoxy-5-acetamino-N,N- bis(2-acetoxyethyl)aniline | 10-digit statistical code | 6.5% |
| 2924.29.20.00 | 2-Acetamido-3-chloro anthra quinone;o-Aceto acetanisidide;o-Acetoacetotoluidide; 2',4'-Acetoacetoxylidide; and 1-Amino-5-benzamido anthra quinone | 10-digit statistical code | 6.5% |
| 2924.29.23.00 | 4-Amino acetanilide; 2,2'-Oxamido bis [ethyl-3-(3,5-di-tert-butyl- 4-hydroxyphenyl) propionate]; Aceto acetsulfanilic acid, potassium salt; and N-(2,3-Dihydroxy propyl)-5-N-(2,3-dihydroxy- propyl) acetamido-N'-(2-hydroxyethyl)- 2,4,6-triiodoisophthalamide | 10-digit statistical code | Free |
| 2924.29.26.00 | 3-Aminomethoxybenzanilide | 10-digit statistical code | Free |
| 2924.29.28.00 | N-[[(4-Chlorophenyl)amino]carbonyl]-2,6- difluorobenzamide; and 3,5-Dichloro-N-(1,1-dimethyl-2-propynyl)- benzamide (Pronamide) | 10-digit statistical code | Free |
| 2924.29.31.00 | 4-Acetamido-2-amino phenol;p-Acetamino benz aldehyde; Aceto acet benzyl amide; Aceto acet-5-chloro-2-toluidide;p-Aceto aceto phenetidide;N-Acetyl-2,6-xylidine (N-Acetyl-2,6- dimethyl aniline);p-Amino benzoic acid iso octyl amide;p-Amino benzoyl amino naphthalene sulfonic acid; 2-Amino-4-chloro benzamide; 3-Amino-4-chloro benzamide; 4-Amino hippuric acid;p-Amino phenyl urethane; 1-Benzamido-4-chloro anthra quinone; 1-Benzamido-5-chloro anthra quinone; Benzanilide; 4'-Chloro aceto acetanilide; 3-(N,N-Dihydroxy ethyl amino) benzanilide; 2,5-Dihydroxy-N-(2-hydroxyethyl)- benzamide; Gentisamide;N,N'-Hexa methylene bis(3,5-di-tert-butyl- 4-hydroxy hydrocinnamamide); 2-(m-Hydroxyanilino) acetamide; Nitra acid amide (1-Amino-9,10-dihydro-N- (3-methoxy propyl)-4-nitro-9,10-dioxo-2- anthramide); Phenacetin, technical; andβ-Resorcyl amide | 10-digit statistical code | 5.8% |
| 2924.29.33.00 | 3-Hydroxy-2-naphthanilide; 3-Hydroxy-2-naphtho-o-toluidide; 3-Hydroxy-2-naphtho-o-anisidine; 3-Hydroxy-2-naphtho-o-phenetidide; 3-Hydroxy-2-naphtho-4-chloro-2,5- dimethoxyanilide; 3-Hydroxy-3'-nitro-2-naphthanilide; andN,N'-Bis(acetoacetyl-o-toluidine) | 10-digit statistical code | Free |
| 2924.29.36.00 | Other | 10-digit statistical code | 6.5% |
| 2924.29.43.00 | 3-Ethoxy carbonyl amino phenyl-N-phenyl carbamate (Desmedipham); and Isopropyl-N-(3-chlorophenyl) car-bamate (CIPC) | 10-digit statistical code | 6.5% |
| 2924.29.47.00 | Other | 10-digit statistical code | 6.5% |
| 2924.29.52.00 | Fast color bases | 10-digit statistical code | 6.5% |
| 2924.29.57.00 | Diethylaminoacetoxylidide (Lidocaine) | 10-digit statistical code | Free |
| 2924.29.62 | Other | 8-digit subheading | 6.5% |
| 2924.29.62.10 | Acetaminophen | 10-digit statistical code | |
| 2924.29.62.20 | Acetophenetidin (Phenacetin) | 10-digit statistical code | |
| 2924.29.62.50 | Other | 10-digit statistical code | |
| 2924.29.65.00 | 5-Bromoacetyl-2-salicylamide | 10-digit statistical code | 6.5% |
| 2924.29.71 | Products described in additional U.S. note 3 to section VI | 8-digit subheading | 6.5% |
| 2924.29.71.10 | 3-oxo-2-phenylbutanamide (alpha-phenylacetoacetamide, APAA) | 10-digit statistical code | |
| 2924.29.71.50 | Other | 10-digit statistical code | |
| 2924.29.77 | Other | 8-digit subheading | 6.5% |
| 2924.29.77.10 | Acetoacetanilide | 10-digit statistical code | |
| 2924.29.77.20 | Acetoacet-2,5-dimethoxy-4- chloroanilide | 10-digit statistical code | |
| 2924.29.77.30 | p-Aminobenzamide | 10-digit statistical code | |
| 2924.29.77.90 | Other | 10-digit statistical code | |
| 2924.29.80.00 | 2,2-Dimethylcyclopropylcarboxamide | 10-digit statistical code | Free |
| 2924.29.95.00 | Other | 10-digit statistical code | 6.5% |
2925Carboxyimide-function compounds (including saccharin and its salts) and imine-function compounds
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2925.11.00.00 | Saccharin and its salts | 10-digit statistical code | 6.5% |
| 2925.12.00.00 | Glutethimide (INN) | 10-digit statistical code | Free |
| 2925.19 | Other | 6-digit heading | |
| 2925.19.10.00 | Ethylenebistetrabromophthalimide | 10-digit statistical code | 6.5% |
| 2925.19.30.00 | Bis(o-tolyl)carbodiimide; and 2,2',6,6'-Tetra isopropyl diphenyl carbodiimide | 10-digit statistical code | Free |
| 2925.19.42.00 | Other | 10-digit statistical code | 6.5% |
| 2925.19.70.00 | N-Chlorosuccinimide; andN,N'-Ethylene bis (5,6-dibromo-2,3- norbornane dicarboximide) | 10-digit statistical code | Free |
| 2925.19.91.00 | Other | 10-digit statistical code | 3.7% |
| 2925.21.00.00 | Chlordimeform (ISO) | 10-digit statistical code | 6.5% |
| 2925.29 | Other | 6-digit heading | |
| 2925.29.10.00 | N'-(4-Chloro-o-tolyl)-N,N- diemthylformamidine; Bunamidine hydrochloride; and Pentamidine | 10-digit statistical code | 6.5% |
| 2925.29.18.00 | N,N'-Diphenylguanidine; 3-Dimethyl amino methyleneiminophenol hydrochloride; 1,3-Di-o-tolylguanidine; andN,N-Dimethyl-N'-[3-[[(methylamino) carbonyl]- oxy] phenyl] methanimidamide monohydro- chloride | 10-digit statistical code | Free |
| 2925.29.20.00 | Drugs | 10-digit statistical code | 6.5% |
| 2925.29.60.00 | Other | 10-digit statistical code | 6.5% |
| 2925.29.70.00 | Tetramethylguanidine | 10-digit statistical code | Free |
| 2925.29.90.00 | Other | 10-digit statistical code | 3.7% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2926.10.00.00 | Acrylonitrile | 10-digit statistical code | 6.5% |
| 2926.20.00.00 | 1-Cyanoguanidine (Dicyandiamide) | 10-digit statistical code | Free |
| 2926.30 | Fenproporex (INN) and its salts; Methadone (INN) intermediate (4-cyano-2-dimethylamino-4,4- diphenylbutane) | 6-digit heading | |
| 2926.30.10.00 | Fenproporex (INN) and its salts | 10-digit statistical code | Free |
| 2926.30.20.00 | 4-Cyano-2-dimethylamino-4,4-diphenylbutane | 10-digit statistical code | 6.5% |
| 2926.40.00.00 | alpha-Phenylacetoacetonitrile | 10-digit statistical code | 6.5% |
| 2926.90 | Other | 6-digit heading | |
| 2926.90.01.00 | 2-Cyano-4-nitroaniline | 10-digit statistical code | Free |
| 2926.90.05.00 | 2-Amino-4-chlorobenzonitrile (5-Chloro-2- cyanoaniline); 2-Amino-5-chlorobenzonitrile; 4-Amino-2-chlorobenzonitrile; (Cyanoethyl)(hydroxyethyl)-m-toluidine;p-Cyanophenyl acetate; Phthalonitrile; and Tetrachloro-3-cyanobenzoic acid, methyl ester | 10-digit statistical code | 6.5% |
| 2926.90.08.00 | Benzonitrile | 10-digit statistical code | 6.5% |
| 2926.90.11.00 | 2,6-Dichlorobenzonitrile | 10-digit statistical code | Free |
| 2926.90.12.00 | Other | 10-digit statistical code | 6.5% |
| 2926.90.14.00 | p-Chlorobenzonitrile; and Verapamil hydrochloride | 10-digit statistical code | 6.5% |
| 2926.90.16.00 | [1α(S*),3α(Z)]-(±)-Cyano(3-phenoxyphenyl)- methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)- 2,2-dimethylcyclopropanecarboxylate | 10-digit statistical code | Free |
| 2926.90.17.00 | o-Chlorobenzonitrile | 10-digit statistical code | 6.5% |
| 2926.90.19.00 | N,N-Bis(2-cyanoethyl) aniline; and 2,6-Difluorobenzonitrile | 10-digit statistical code | Free |
| 2926.90.21.00 | Fungicides | 10-digit statistical code | 6.5% |
| 2926.90.23.00 | 3,5-Dibromo-4-hydroxybenzonitrile (Bromoxynil) | 10-digit statistical code | 6.5% |
| 2926.90.25.00 | Other | 10-digit statistical code | 6.5% |
| 2926.90.30.00 | Other | 10-digit statistical code | 6.5% |
| 2926.90.43.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2926.90.48.01 | Other | 10-digit statistical code | 6.5% |
| 2926.90.50 | Other | 8-digit subheading | Free |
| 2926.90.50.10 | Malononitrile | 10-digit statistical code | |
| 2926.90.50.50 | Other | 10-digit statistical code |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2927.00.03.00 | 4-Aminoazobenzenedisulfonic acid, monosodium salt | 10-digit statistical code | Free |
| 2927.00.06.00 | p-Aminoazobenzenedisulfonic acid; and Diazoaminobenzene (1,3-Diphenyltriazene) | 10-digit statistical code | 5.8% |
| 2927.00.15.00 | 1,1'-Azobisformamide | 10-digit statistical code | 3.7% |
| 2927.00.18.00 | 1-Naphthalenesulfonic acid, 6-diazo-5,6-dihydro-5-oxo, ester with phenyl(2,3,4-trihydroxyphenyl)methanone; 1-Naphthalenesulfonic acid, 3-diazo-3,4-dihydro-4- oxo-ar'-(1-methylethyl) [1,1'-biphenyl]-4-yl ester; 1-Napthanlenesulfonic acid, 6-diazo-5,6-dihydro-5- oxo-,(octahydro-4,7-methano-1H-indene-2,5-diyl) bis- (methylene) ester; and 1-Naphthalenesulfonic acid, 6-diazo-5,6-dihydro-5- oxo-, 4-benzoyl-1,2,3-benzenetriyl ester | 10-digit statistical code | Free |
| 2927.00.25.00 | Photographic chemicals | 10-digit statistical code | 6.5% |
| 2927.00.30.00 | Fast color bases and fast color salts | 10-digit statistical code | 6.5% |
| 2927.00.40.00 | Products described in additional U.S. note 3 to section VI | 10-digit statistical code | 6.5% |
| 2927.00.50.00 | Other | 10-digit statistical code | 6.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2928.00.10.00 | Methyl ethyl ketoxime | 10-digit statistical code | 3.7% |
| 2928.00.15.00 | Phenylhydrazine | 10-digit statistical code | Free |
| 2928.00.25.00 | Aromatic | 10-digit statistical code | 6.5% |
| 2928.00.30.00 | Drugs | 10-digit statistical code | 3.7% |
| 2928.00.50.00 | Other | 10-digit statistical code | 6.5% |
| HTS code | Description | Level | General duty rate |
|---|---|---|---|
| 2929.10 | Isocyanates | 6-digit heading | |
| 2929.10.10.00 | Toluenediisocyanates (unmixed) | 10-digit statistical code | 6.5% |
| 2929.10.15.00 | Mixtures of 2,4- and 2,6-toluenediisocyanates | 10-digit statistical code | 6.5% |
| 2929.10.20.00 | Bitolylene diisocyanate (TODI);o-Isocyanic acid, o-tolyl ester; and Xylene diisocyanate | 10-digit statistical code | 5.8% |
Not sure which line applies?
Classification follows the General Rules of Interpretation: the most specific description wins, and you must use a 10-digit statistical code on the entry. When two lines look equally plausible, a CBP binding ruling is the only way to be certain.
Source: USITC Harmonized Tariff Schedule, 2026 Basic Edition, Revision 16. Rate text is reproduced verbatim from the official export; category paths and duty estimates are derived.
Data loaded August 18, 2026.Check this chapter on hts.usitc.govReport an errorHow this data is built